Physics, 18.06.2020 22:57 meganjackson155

The cost of energy delivered to residences by electrical transmission varies from $0.070/kWh to $0.258/kWh throughout the United States; $0.110/kWh is the average value. At this average price, calculate the cost of:. (a) leaving a 40.0-W porch light on for two weeks while you are on vacation,
(b) making a piece of dark toast in 3.00 min with a 970-W toaster, and
(c) drying a load of clothes in 40.0 min in a 5.20 3 103-W dryer

Answers: 2

Show answers

Answers

Answer from: rachael382

(a) $ 1.48

(b) $ 0.005

Explanation:

(a)

First, we calculate the energy consumed, by using following formula:

E = Pt

where,

E = Energy Consumed = ?

P = Power Delivered = (40 W)(1 KW/1000 W) = 0.04 KW

t = Time Duration = (2 weeks)(7 days/week)(24 h/day) = 336 h

Therefore,

E = (0.04 KW)(336 h) = 13.44 KWh

Now, we calculate cost, by following formula:

Cost = (E)(Unit Price)

Cost = (13.44 KWh)($ 0.11/KWh)

Cost = $ 1.48

(b)

First, we calculate the energy consumed, by using following formula:

E = Pt

where,

E = Energy Consumed = ?

P = Power Delivered = (970 W)(1 KW/1000 W) = 0.97 KW

t = Time Duration = (3 min)(1 h/60 min) = 0.05 h

Therefore,

E = (0.97 KW)(0.05 h) = 0.0485 KWh

Now, we calculate cost, by following formula:

Cost = (E)(Unit Price)

Cost = (0.0485 KWh)($ 0.11/KWh)

Cost = $ 0.005

(c)

First, we calculate the energy consumed, by using following formula:

E = Pt

where,

E = Energy Consumed = ?

P = Power Delivered = (5.203 x 10³ W)(1 KW/1000 W) = 5.203 KW

t = Time Duration = (40 min)(1 h/60 min) = 0.67 h

Therefore,

E = (5.203 KW)(0.67 h) = 3.47 KWh

Now, we calculate cost, by following formula:

Cost = (E)(Unit Price)

Cost = (3.47 KWh)($ 0.11/KWh)

Cost = $ 0.38

Answer from: Quest

where's the following? you gotta add it to know what the choices are

explanation:

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 17:40

Which is not a source of noise pollution? a)airplanes b)acid rain c)machines d)cars

Answers: 2

Answer

Physics, 21.06.2019 19:30

Agymnast dismounts off the uneven bars in a tuck position with a radius of 0.3m (assume she is a solid sphere) and an angular velocity of 2rev/s. during the dismount she stretches out into the straight position, with a length of 1.5m, (assume she is a uniform rod through the center) for her landing. the gymnast has a mass of 50kg. what is her angular velocity in the straight position?

Answers: 2

Answer

Physics, 22.06.2019 01:10

The x-coordinate of a particle in curvilinear motion is given by x = 3.1t3 - 4.9t where x is in feet and t is in seconds. the y-component of acceleration in feet per second squared is given by ay = 2.3t. if the particle has y-components y = 0 and vy = 5.0 ft/sec when t = 0, find the magnitudes of the velocity v and acceleration a when t = 1.8 sec. sketch the path for the first 1.8 seconds of motion, and show the velocity and acceleration vectors for t = 1.8 sec. answers: v = ft/sec a = ft/sec2

Answers: 2

Answer

Physics, 22.06.2019 07:20

Diamond will scratch quartz. true or false

Answers: 2

Answer

You know the right answer?

The cost of energy delivered to residences by electrical transmission varies from $0.070/kWh to $0.2...

Questions