Convert the condensed structures to line angle formulas: 1. ch3ch2ch(ch3)ch2ch3 8. ch: coch 9. ch3ch2och3 2. ch3ch2ch(ch2ch3)ch(ch3)ch2cho ch)ch: ch-ch: 10. ch ch2ch=c(ch: ch)(c(ch))ch 3. ch3ch2ch(ch3)ch(ch3)ch2ch3 11. ch: ch-ch(ch2ch)ch oh 4. ch3c(ch3)2ch2ch2ch(ch3)ch2ch3 12. chchoch2cho 5. ch(ch3)2ch(ci)ch2ch3 13. hoocch2nhch(ch3)coch; 6. ch3ch2choch(ch2ch3)ch2ch3 14. hoocch och cooh 7. hoch: c(ch3)2conh2

Attached in the photo.

Explanation:

Hello,

The answers in the attached photo. Just three things:

- In the second point a parenthesis is missing to properly understand the molecule (after the oxygen), nevertheless, I assumed it was an ether.

- In the sixth point, there's a missing hydrogen for it to be an ether as well.

- In the tenth point the second parenthesis is not clear, it seems there's a missing subscript, nevertheless I draw it assuming complete octates.

Best regards.

first let us lay out the formula for potential

and kinetic energy:

pe = mgh

ke = (mv^2)/2

where: m=mass, v=velocity, g=gravitational

acceleration, h=height

calculating for mass using the known values of

pe:

340j = m (9.81 m/s^2) (50ft) (1m/3.28ft)

m = 2.27 kg

the law of conservation of energy states that

energy is neither created nor destroyed. therefore, the change in kinetic

energy from 50 ft to 35 ft would be equal to the change in potential energy

from 50 ft to 35 ft. however it would be opposite in signs since one is losing

while other is gaining.

ke(35ft) – ke(50ft) = - [ pe(35ft) – pe(50ft]

ke(50ft) = 0 since the brick is initially at rest

ke(35ft) = 340j - 2.27kg (9.81 m/s^2) (35ft)

(1m/3.28 ft)

ke(35ft)

= 102.38 j

each chemical family is represented as a group or column on the periodic table. based on chemical properties, there are 6 types of chemical families. group 1 represents alkali metals, group 2 represents alkaline earth metals, groups 3 to 12 represent transition metals, groups 13 to 16 represent non-metals and other metals, group 17 represents halogens and group 18 represents noble gases.