subject
Chemistry, 25.11.2019 23:31 staxmillz

When comparing the ir spectra of the two compounds below, what absorption(s) would allow you to distinguish the compounds? hc≡cch2n(ch2ch3)2andch3(ch2)5c≡n strong, broad peak at 3600−3200 cm−1 medium peak at 3500−3200 cm−1 medium peak at 3300 cm−1 medium peak at 3150−3000 cm−1 strong peak at 3000−2850 cm−1 medium peak at 2250 cm−1 strong peak at ~1700 cm−1 medium peak at at 1650 cm−1 medium peak at 1600, 1500 cm−1 no distinguishing peaks

ansver
Answers: 1

Another question on Chemistry

question
Chemistry, 21.06.2019 13:00
Covalent bonds are formed between metals and boiling points true or false
Answers: 2
question
Chemistry, 21.06.2019 13:00
Note the ph and poh values labeled with letters on the ph scale below. based on log rules and the way ph is calculated, what is the difference in [oh– ] concentration between point a and point b. a) 10^1 b) 10^5 c) 10^6 d) 10^7
Answers: 1
question
Chemistry, 22.06.2019 07:30
Calculate the ratio of h+ ions to oh– ions at a ph = 7. find the concentration of h+ ions to oh– ions listed in table b of your student guide. then divide the h+ concentration by the oh– concentration. record this calculated ratio in table a of your student guide. compare your approximated and calculated ratios of h+ ions to oh– ions at a ph = 7. are they the same? why or why not? record your comparison in table a. what is the concentration of h+ ions at a ph = 7? mol/l what is the concentration of oh– ions at a ph = 7? mol/l what is the ratio of h+ ions to oh– ions at a ph = 7? : 1
Answers: 1
question
Chemistry, 22.06.2019 11:00
When hydrochloric acid reacts with potassium hydroxide solution, the following reaction occurs. hcl (aq) + koh (aq) h2o (l) + kcl (aq) the reaction gives off heat energy, so it is an reaction.
Answers: 1
You know the right answer?
When comparing the ir spectra of the two compounds below, what absorption(s) would allow you to dist...
Questions
question
Mathematics, 13.02.2021 08:50
question
Biology, 13.02.2021 08:50
question
Arts, 13.02.2021 08:50
question
Business, 13.02.2021 08:50
question
Biology, 13.02.2021 08:50
question
Biology, 13.02.2021 08:50
question
Mathematics, 13.02.2021 08:50
question
English, 13.02.2021 08:50
question
English, 13.02.2021 08:50
question
Biology, 13.02.2021 08:50
question
Arts, 13.02.2021 08:50
Questions on the website: 13722362