When the 1,7-diester CH3O2CCH2CH2CH(CH3)CH2CH2CO2CH3 is treated with sodium methoxide and the reaction mixture is subsequently neutralized with acid, what kind of compound is the major organic product

Determine the number of moles of air present in 1.35 l at 750 torr and 17.0°c. which equation should you use? n=pv/rt what is the number of moles present? ⇒ 0.056 mol a sample of n2 gas occupying 800.0 ml at 20.0°c is chilled on ice to 0.00°c. if the pressure also drops from 1.50 atm to 1.20 atm, what is the final volume of the gas? which equation should you use? v2= p1v1t2/p2t1 what is the final volume of the gas? ⇒ 932 ml these are the answers