When the 1,7-diester CH3O2CCH2CH2CH(CH3)CH2CH2CO2CH3 is treated with sodium methoxide and the reaction mixture is subsequently neutralized with acid, what kind of compound is the major organic product

Click the button that shows the correct relationship of the electron affinities of the elements sodium and phosphorus. sodium’s electron affinity value is more negative than the electron affinity value of phosphorus. phosphorus’ electron affinity value is more negative than the electron affinity value of sodium. this information cannot be determined using the periodic table. answer is b on e2020.