Which of the following is the correct structure of 2-methyl-3-heptene a. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3
b. CH3-CH2CH=CH-CH2CH(CH3)-CH3
c. CH3-CH2-CH=CH-CH-(CH3)-CH2-CH3
d. CH3-CCH(CH3)-CH=CH-CH2CH2-CH3

Frictional forces acting on an object are often converted into energy, which causes the temperature of the object to rise slightly.

For each of the compounds below, show that the charges on the ions add up to zero. a. kbr b. cao c. li(2)o d. cacl(2) e. alcl(3)

Which of the following is an example of physical change not a chemical change? a) a log gives off heat and light as it burns. b) a tree stores energy from the sun in its fruit. c) a penny lost in the grass slowly changes color. d) a water pipe freezes and cracks on a cold night.