Draw this molecule in the form of bond line figure.

CHOCH2CH(CH2CH3)CON(CH3)2

You just calculated that the heat of fusion for chloromethane is 6400 j/mol. the heat of fusion for hydrogen is 120 j/mol.? which of the following account for this difference? more than one correcta. chloromethane can absorb more energy at the same temperature. b. hydrogen has stronger intermolecular forces than chloromethane. c. hydrogen molecules can pack more closely than chloromethane molecules. d. chloromethane experiences dipole-dipole interactions. e. chloromethane has a higher molar mass than hydrogen.

The diagin dilutepage 6 of 12a6a5(a)fluorine, chlorine, bromine and iodine are placed in the same group of theperiodic table.state the common name used to describe elements in this group.(i)state the group in which the elements are placed and explain whythey are placed in that group.(ii)which of the above named elements is a solid at roomtemperature and pressure?

1) a light bulb takes in 30 of energy per second. it transfers 3j as use energy. calculate the efficiency. second. it transfers 3j as useful light energy and 27j as heat energy. calculate the efficiency