Balance equation Co2(CO3)3(s)=Co2O3(s)+CoO2(g)

Apush or pull that moves or changes and object when to objects touch

Give a real-world example of an energy transformation that uses two of the following forms of energy: chemical, mechanical, nuclear, gravitational, radiant, electrical, thermal (heat), and/or sound.

What is the difference between covalent bonds and ionic bonds? covalent bonds involve the sharing of electrons between atoms; ionic bonds involve the electrical attraction between charged atoms. covalent bonds involve the transfer of electrons between charged atoms; ionic bonds involve the sharing of electrons between atoms. covalent bonds involve the sharing of pairs of electrons between atoms; ionic bonds involve the sharing of single electrons between atoms. covalent bonds involve the sharing of electrons between atoms; ionic bonds involve the sharing of protons between charged atoms.