![subject](/tpl/images/cats/himiya.png)
Chemistry, 19.03.2021 02:20 alyssarene16
For each of the following balanced equations, calcu- late how many grams of each product would form if 12.5 g of the reactant listed first in the equation re- acts completely (there is an excess of the second re- actant). a. SiC(s)+2Cl2(g)=SiCl4(l)+C(s)
b. Li2O(s)+H2O(l)=2LiOH(aq)
c.2Na2O2(s)+2H2O(l)=4NaOH(aq)+O2( g)
d. SnO2(s)+2H2(g)=Sn(s)+2H2O(l)
![ansver](/tpl/images/cats/User.png)
Answers: 1
![](/tpl/images/ask_question.png)
![](/tpl/images/ask_question_mob.png)
Another question on Chemistry
![question](/tpl/images/cats/himiya.png)
Chemistry, 22.06.2019 05:30
According to periodic trend, which of the following most likely has the highest ionization energy? kr be ni sc
Answers: 3
![question](/tpl/images/cats/himiya.png)
Chemistry, 22.06.2019 16:00
1. an experiment in your science class lists the materials needed for the lab. it is your job, as a lab partner, to measure out 25 ml of distilled water and 2.5 grams of magnesium. what lab measuring tools would you choose to measure each substance and how would you use each tool to get the correct amounts? be sure to describe the process you would follow step-by-step. (5 points) 2.which of the following is an si base unit for measuring mass? (2 points) ampere gram meter pound 3.which of the following is an si base unit for time? (2 points) decades hours minutes seconds 4.which of the following tools should a scientist use to measure an object in milligrams? (2 points) graduated cylinder pan balance tape measure thermometer 4.which of the following tools should a scientist use to measure an object in milligrams? (2 points) graduated cylinder pan balance tape measure thermometer. 5.a pencil beside a metric ruler. the ruler is scaled from 1 centimeter to 10 centimeters, with markings for millimeters between each number. one end of the pencil is beside the 0 on the ruler, and the pencil point is beside the 5. which of the following measurements is accurate but not precise? (2 points) 5 mm 5 cm 50 mm 50 cm 6. which of the following prefixes represents the largest value? (2 points) giga hector kilo milli 7. which of the following types of graphs is best for plotting the percentages of a whole value in a data set? (2 points) bar graph circle graph histogram line graph
Answers: 1
![question](/tpl/images/cats/himiya.png)
Chemistry, 22.06.2019 22:20
How do cfcs cause ozone depletion? how do cfcs cause ozone depletion? ultraviolet radiation breaks down cfcs, molecules containing chlorine. chlorine then breaks one oxygen atom away from ozone, leaving behind a paired oxygen molecule. ultraviolet radiation breaks down cfcs, molecules containing chlorine. chlorine then breaks two oxygen atoms away from ozone, leaving behind a paired oxygen molecule. ultraviolet radiation creates cfcs, molecules containing chlorine. chlorine then breaks two oxygen atoms away from ozone, leaving behind a paired oxygen molecule. ultraviolet radiation creates cfcs, molecules containing chlorine. chlorine then breaks one oxygen atom away from ozone, leaving behind a paired oxygen molecule.
Answers: 2
![question](/tpl/images/cats/himiya.png)
Chemistry, 22.06.2019 23:10
Amines are good nucleophiles, even though they are neutral molecules. how would the rate of an sn2 reaction between an amine and an alkyl halide be affected if the polarity of the solvent is increased? amines are good nucleophiles, even though they are neutral molecules. how would the rate of an reaction between an amine and an alkyl halide be affected if the polarity of the solvent is increased? because both reactants in the rate-limiting step are neutral, the reaction will be faster if the polarity of the solvent is increased. because both reactants in the rate-limiting step are neutral, the reaction will be slower if the polarity of the solvent is increased. because both reactants in the rate-limiting step are neutral, the reaction will occur at the same rate if the polarity of the solvent is increased. request answer
Answers: 3
You know the right answer?
For each of the following balanced equations, calcu- late how many grams of each product would form...
Questions
![question](/tpl/images/cats/mat.png)
Mathematics, 03.06.2020 13:08
![question](/tpl/images/cats/mat.png)
Mathematics, 03.06.2020 13:08
![question](/tpl/images/cats/mat.png)
Mathematics, 03.06.2020 13:08
![question](/tpl/images/cats/en.png)
English, 03.06.2020 13:08
![question](/tpl/images/cats/istoriya.png)
History, 03.06.2020 13:08
![question](/tpl/images/cats/mat.png)
Mathematics, 03.06.2020 13:08
![question](/tpl/images/cats/istoriya.png)
History, 03.06.2020 13:08
![question](/tpl/images/cats/mat.png)
Mathematics, 03.06.2020 13:08
![question](/tpl/images/cats/himiya.png)
Chemistry, 03.06.2020 13:08
![question](/tpl/images/cats/mat.png)
Mathematics, 03.06.2020 13:08
![question](/tpl/images/cats/obshestvoznanie.png)
Social Studies, 03.06.2020 13:08
![question](/tpl/images/cats/istoriya.png)
![question](/tpl/images/cats/en.png)
![question](/tpl/images/cats/istoriya.png)
History, 03.06.2020 13:08
![question](/tpl/images/cats/mat.png)
Mathematics, 03.06.2020 13:08
![question](/tpl/images/cats/mat.png)
Mathematics, 03.06.2020 13:08
![question](/tpl/images/cats/mat.png)
Mathematics, 03.06.2020 13:08
![question](/tpl/images/cats/himiya.png)
Chemistry, 03.06.2020 13:08
![question](/tpl/images/cats/mat.png)
Mathematics, 03.06.2020 13:08
![question](/tpl/images/cats/mat.png)
Mathematics, 03.06.2020 13:08