For each of the following balanced equations, calcu- late how many grams of each product would form if 12.5 g of the reactant listed first in the equation re- acts completely (there is an excess of the second re- actant). a. SiC(s)+2Cl2(g)=SiCl4(l)+C(s)​ b. Li2O(s)+H2O(l)=2LiOH(aq)
c.2Na2O2(s)+2H2O(l)=4NaOH(aq)+O2( g)
d. SnO2(s)+2H2(g)=Sn(s)+2H2O(l)

According to periodic trend, which of the following most likely has the highest ionization energy? kr be ni sc

1. an experiment in your science class lists the materials needed for the lab. it is your job, as a lab partner, to measure out 25 ml of distilled water and 2.5 grams of magnesium. what lab measuring tools would you choose to measure each substance and how would you use each tool to get the correct amounts? be sure to describe the process you would follow step-by-step. (5 points) 2.which of the following is an si base unit for measuring mass? (2 points) ampere gram meter pound 3.which of the following is an si base unit for time? (2 points) decades hours minutes seconds 4.which of the following tools should a scientist use to measure an object in milligrams? (2 points) graduated cylinder pan balance tape measure thermometer 4.which of the following tools should a scientist use to measure an object in milligrams? (2 points) graduated cylinder pan balance tape measure thermometer. 5.a pencil beside a metric ruler. the ruler is scaled from 1 centimeter to 10 centimeters, with markings for millimeters between each number. one end of the pencil is beside the 0 on the ruler, and the pencil point is beside the 5. which of the following measurements is accurate but not precise? (2 points) 5 mm 5 cm 50 mm 50 cm 6. which of the following prefixes represents the largest value? (2 points) giga hector kilo milli 7. which of the following types of graphs is best for plotting the percentages of a whole value in a data set? (2 points) bar graph circle graph histogram line graph

How do cfcs cause ozone depletion? how do cfcs cause ozone depletion? ultraviolet radiation breaks down cfcs, molecules containing chlorine. chlorine then breaks one oxygen atom away from ozone, leaving behind a paired oxygen molecule. ultraviolet radiation breaks down cfcs, molecules containing chlorine. chlorine then breaks two oxygen atoms away from ozone, leaving behind a paired oxygen molecule. ultraviolet radiation creates cfcs, molecules containing chlorine. chlorine then breaks two oxygen atoms away from ozone, leaving behind a paired oxygen molecule. ultraviolet radiation creates cfcs, molecules containing chlorine. chlorine then breaks one oxygen atom away from ozone, leaving behind a paired oxygen molecule.