Chemistry, 26.03.2021 20:30 khaylaperry
1.) Draw the amide formed when 1‑methylethylamine (CH3CH(CH3)NH2) is heated with each carboxylic acid.
CH3CH2CH2COOH+CH3CH(CH3)NH2⟶
2.)Give the systematic (IUPAC) names for these molecules.
This molecule has the condensed formula C H 3 C H 2 C O O (C 6 H 5). C 6 H 5 is a benzene ring.
IUPAC name
Answers: 2
Chemistry, 21.06.2019 19:30
The ph of carrots are 5.0 how it is classified a.acidic b.basic c.indicator d.neutral
Answers: 2
Chemistry, 22.06.2019 11:00
Which statement correctly identifies the scientific question and describes why the question is scientific? question 1 refers to the supernatural.question 2 reflects a moral or social value.question 3 refers to something that can be measured.question 4 reflects a question that can’t be observed.
Answers: 1
Chemistry, 22.06.2019 13:00
If two objects at different te,peraure are in contact with each other what happens to their temperature
Answers: 1
1.) Draw the amide formed when 1‑methylethylamine (CH3CH(CH3)NH2) is heated with each carboxylic aci...
Mathematics, 05.06.2021 01:00
Mathematics, 05.06.2021 01:00
Mathematics, 05.06.2021 01:00
Mathematics, 05.06.2021 01:00
Biology, 05.06.2021 01:00
Mathematics, 05.06.2021 01:00
Mathematics, 05.06.2021 01:00
English, 05.06.2021 01:00