Blance this out ! ba(cn)2+2h2so4=baso4+2hcn

The minerals found in bones are deposited by living cells called

For each of the compounds below, show that the charges on the ions add up to zero. a. kbr b. cao c. li(2)o d. cacl(2) e. alcl(3)

An excess of lithium oxide undergoes a synthesis reaction with water to produce lithium hydroxide li2o+h2o→2lioh if 1.05 g of water reacted, what is the theoretical yield of lithium hydroxide? a) 5.83 x 10–2 g lioh b) 1.17 x 10–1 g lioh c) 2.79 x 100 g lioh d) 1.40 x 100 g lioh