Cunoscand urmatoarele date termodinamice CH4(g) +2O2(g)= CO2(g)+2H2O(g) ΔH1=-203 kj/mol
4HCl(g) + O2= 2H2O(g) +2Cl2(g) ΔH2=-116kj/mol
CH3Cl(g)+H2O=CH3OH(g)+HCl(g) ΔH3=-3kj/mol
CH3Oh(g) +3O2(g)=2CO2+4H2O ΔH4=-1300kj/mol

calculeze variatia de entalpie in conditii standard pt reactia CH4(g)+Cl2(g)=CH3Cl(g)

pla·gia·rism

/ˈplājəˌrizəm/

learn to pronounce

noun

the practice of taking someone else's work or ideas and passing them off as one's own.

explanation:

answer: enthalpy

explanation:

for a exothermic reaction, the energy is released i.e. the energy of the products is lower than the energy of the reactants.

= enthaply

= energy of products

= energy of reactants

as , thus comes out to be negative. negative value of enthalpy shows that the reaction is exothermic.

the correct answer is:

a. formation of precipitation

you gotta add the following molecules so we can give u an answer

explanation: