Chemistry, 06.08.2021 23:50 faithyholcomb
Consider the reaction: NaNO3(s)+H2SO4(l)NaSO4(s)+HNO3 delta H= 21.2kj How much heat is absorbed by the reaction system to convert 100g of NaNO3 into NaHSO4(s)?
Answers: 3
Chemistry, 22.06.2019 03:30
Asample of ammonia reacts with oxygen as shown. 4nh3(g) + 5o2(g) 4no(g) + 6h2o(g) what is the limiting reactant if 4.0 g of nh3 react with 8.0 g of oxygen? o2 because it produces only 0.20 mol of no. nh3 because it produces only 0.20 mol of no. o2 because it produces two times less no than nh3. nh3 because it produces three times more no than o2.
Answers: 3
Chemistry, 22.06.2019 06:30
Predict whether the changes in enthalpy, entropy, and free energy will be positive or negative for the boiling of water, and explain your predictions. how does temperature affect the spontaneity of this process?
Answers: 1
Chemistry, 22.06.2019 16:30
An atom with 7 protons, 6 neutrons, and 7 electrons has an atomic mass of amu. (enter a whole number.) numerical answers expected! answer for blank 1:
Answers: 3
Chemistry, 22.06.2019 21:50
Given the data below for the reaction, 2 a + 2 b + 4 c => d + e + 3 f, the reaction is fill in the [ ] order in a, fill in the [ ] order in b, fill in the [ ] order in c and fill in the [ ] order overall. (use the words "first, second, third, fourth" to fill each blank)experimentinitial conc of a, mol/l initial conc of b, mol/l initial conc of c, mol/l initial rate, mol/l.s1 0.1 0.1 0.2 2 x 10-32 0.2 0.3 0.2 6 x 10-33 0.3 0.1 0.2 2 x 10-34 0.4 0.3 0.4 1.2 x 10-2
Answers: 2
Consider the reaction: NaNO3(s)+H2SO4(l)NaSO4(s)+HNO3 delta H= 21.2kj
How much heat is absorbed by...
Mathematics, 18.09.2019 22:00
History, 18.09.2019 22:00
History, 18.09.2019 22:00
Mathematics, 18.09.2019 22:00
English, 18.09.2019 22:00
History, 18.09.2019 22:00
Mathematics, 18.09.2019 22:00
Biology, 18.09.2019 22:00
Biology, 18.09.2019 22:00
Mathematics, 18.09.2019 22:00