subject
Chemistry, 20.08.2021 14:00 limelight11

FeS+H2SO4=Fe2(SO4)3+SO2+H2O

ansver
Answers: 3

Another question on Chemistry

question
Chemistry, 22.06.2019 14:30
How do temperature and salinity affect deepwater currents? as temperatures and salinity levels of water increase, the water rises to the surface where it creates currents as it moves to colder regions. they create changes in wind direction, moving denser water in the same direction as the wind and causing the deepwater circulation patterns found in the ocean. they equalize the forces on undersea currents caused by the coriolis effect as they replace more dense water with less dense water. they create density differences that cause dense deepwater currents to flow toward the equator where they displace less dense, warmer water above them.
Answers: 2
question
Chemistry, 22.06.2019 17:00
The arrangement of particles is most ordered in a sample of
Answers: 1
question
Chemistry, 23.06.2019 01:50
Ablock of aluminum is dropped into a graduated cylinder with an initial volume of water at 75ml and the volumes rises to 90ml. if the block has a mass of 40.5 g what is its density ?
Answers: 1
question
Chemistry, 23.06.2019 04:30
Two liquids are poured into a beaker. after a few seconds, the beaker becomes warm. which of the following best describes this reaction? a. an exothermic reaction b. a decomposition reaction c. an endothermic reaction d. a single-displacement reaction
Answers: 1
You know the right answer?
FeS+H2SO4=Fe2(SO4)3+SO2+H2O...
Questions
question
English, 18.07.2019 03:00
Questions on the website: 13722361