Physics, 17.07.2019 03:00 grayammip095l9

Do tomarrow what is the total resistance in the following diagram? a. 1. total 2. if the battery has a voltage of 25 volts, what would be its current?

Answers: 1

Show answers

Answers

Answer from: tia0625

The total resistance is

R₁ + R₂ + [ (R₃R₄)/(R₃ + R₄) ] .

It's not possible to give you the number, because you haven't
told us the actual resistance of any of the four resistors.

The current supplied by the battery is

(the voltage of the battery)
divided by
(the resistance described above in part-1) .

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

can u provide the graph and if its not possible

then i can tell u the segment where the

average time interval starts degrading is the segment where the car is slowing down

Another question on Physics

Physics, 21.06.2019 16:00

As shown in fig. p3.64, a closed, rigid tank fitted with a fine-wire electric resistor is filled with refrigerant 22, initially at 2108c, a quality of 80%, and a volume of 0.01 m3. a 12-volt battery provides a 5-amp current to the resistor for 5 minutes. if the final temperature of the refrigerant is 408c, determine the heat transfer, in kj, from the refrigerant.

Answers: 1

Answer

Physics, 21.06.2019 19:30

Two identical 82 mg dust particles very far apart (pee 0) are moving directly toward each other at a speed of 3698 m/s. the charge on each is-719 ? c. determine how close they will get to each other. let k = 9x109 n-m2/c2 & ignore gravity.

Answers: 1

Answer

Physics, 22.06.2019 05:30

Anybody wanna ? (picture included? )

Answers: 1

Answer

Physics, 22.06.2019 10:00

This is important 1. what happens to the speed of molecules in water vapor when it condenses to form a liquid? (2 points) the molecules slow down. the molecules speed up. the molecules slow down and then speed up. the molecules speed up and then slow down. 2. how might human activities change to compensate for a decrease in water supplies? (2 points) humans might build a factory. humans might build drainage systems. humans might extract more water from the ground. human behavior does not change because of the water cycle. i'll be grateful if anyone can answer these 2 questions !

Answers: 1

Answer

You know the right answer?

Do tomarrow what is the total resistance in the following diagram? a. 1. total 2. if the battery ha...

Questions