Physics, 06.01.2020 14:31 savannnab1890

Jane works at a grocery store. she has a large crate of bananas with a mass of 13 kg to move to the produce aisle.

a. what is the weight of the crate?

b. what is the normal force acting on the crate when it sits on the floor? explain how you found the answer.

c. if she pushes on the box with a force of 40 n and there is no friciton, what is the acceleraiton of the box?

d. if the coefficient of static friction between the crate and the floor is 0.2, what si the maximum force of static friction acting on the crate?

e. if she pushes on the crate with a force of 12 n, what is the force of static friction on the crate ? explain how you found the answer.

f. if she pushes on the create with a force of 40 n, and the coefficient of kinetic friction is 0.15, what is the net force on the create in the x-direction?

g. based on your answer in part (f), what is the acceleration of the crate?

Answers: 3

Show answers

Answers

Answer from: cici86

PART a)

As we know that weight is product of mass and gravity

so here we have

W = mg

W = 13(9.8) = 127.4 N

Part B)

Normal force is counter balanced by weight of the crate

so here we have

N = W = 127.4 N

PART C)

As we know that

F = ma

now we have

m = 13 kg

F = 40 N

now we have

40 = 13(a)

a = 3.08 m/s^2

Part D)

Maximum static friction force is given as

$F_s = \mu_s N$

here we know that

$\mu_s = 0.2$

now we have

F_s = 0.2(127.4) = 25.48 N

PART E)

Since applied force on the block is

F = 12 N

Now since applied force is less than maximum static friction force

So it will not slide

So here friction force will be same as applied force

Static friction = 12 N

PART f)

Kinetic friction force is given as

$F_k = \mu_k N$

here we know that

$\mu_k = 0.15$

now friction force is

F_k = 0.15(127.4) = 19.11 N

now we have

$F_{net} = F - F_k$

$F_{net} = 40 - 19.11$

$F_{net} = 20.89 N$

Part g)

as we know that

F = ma

20.89 = 13a

a = 1.61 m/s^2

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

100 pounds is 100 pounds no matter the object or item being weighed

Another question on Physics

Physics, 22.06.2019 08:50

You are a sales representative for a company that makes a new alternate fuel for vehicles. you have prepared a presentation for the environmental engineers to sell your new product. what question do you expect the audience to ask regarding whether the new fuel will cause less damage to the environment? a. do we have to change any parts of the vehicle to use this alternate fuel? b. will the vehicles get better fuel mileage with the alternate fuel? c. how much greenhouse gas does your fuel produce compared with current fuel sources? d. is the alternate fuel more expensive than fossil fuel?

Answers: 2

Answer

Physics, 22.06.2019 11:00

Aperson walks first at a constant speed of 4.89 m/s along a straight line from point a to point b and then back along the line from b to a at a constant speed of 2.95 m/s. what is the average speed over the entire trip?

Answers: 1

Answer

Physics, 22.06.2019 17:40

Along wire carrying a 4.2 a current perpendicular to the xy-plane intersects the x-axis at x=−1.7cm. a second, parallel wire carrying a 3.0 a current intersects the x-axis at x=+1.7cm. part a at what point on the x-axis is the magnetic field zero if the two currents are in the same direction? express your answer to two significant figures and include the appropriate units.

Answers: 2

Answer

Physics, 22.06.2019 18:40

Which body is in equilibrium? (1) a satellite orbiting earth in a circular orbit (2) a ball falling freely toward the surface of earth (3) a car moving with a constant speed along a straight, level road (4) a projectile at the highest point in its trajectory

Answers: 2

Answer

You know the right answer?

Jane works at a grocery store. she has a large crate of bananas with a mass of 13 kg to move to the...

Questions