Physics, 01.08.2019 01:10 georgesk2030

Aparticular satellite with a mass of m is put into orbit around ganymede (the largest moon of jupiter) at a distance 300 km from the surface. what is the gravitational force of attraction between the satellite and the moon? (ganymede has a mass of 1.48x1023 kg and a radius of 2631 km.)

Answers: 2

Show answers

Answers

Answer from: Ashleymsmith

3.36m or 1680 N

Explanation:

Given:

Mass of the satellite =m

Mass of the moon Ganymede, M = 1.48 × 10²³ kg

Radius of Ganymede, R = 2631 km

Distance of satellite above the surface of the moon, d = 300 km

According to Universal Gravitational law:

$F=\frac{GMm}{(R+d)^2}$

where, G is the gravitational constant, M and m are mass of the objects and (R+d) is the distance between the centers of the objects.

Substitute the values:

$F=\frac{6.67\times 10^{-11}\times 1.48 \times 10^{23} m}{(2.931\times 10^6)^2}=3.36m$

If we consider mass of a satellite to be about 500 kg, the gravitational force between the moon and the satellite would be:

$F = 3.36\times 500 = 1680 N$

Answer from: Quest

0.55x745.7j and a calculator

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 01:00

4. who was the first one to measure the speed of light and conclude that it is finite? 5. who was the first philosopher who thought the speed of light is finite? 13. what is the speed of light numerically? 14. give an example of something moving faster than light 15. give an example for some particles or waves that

Answers: 1

Answer

Physics, 22.06.2019 14:50

Nitrogen (n2) undergoes an internally reversible process from 6 bar, 247°c during which pν1.2 = constant. the initial volume is 0.1 m3 and the work for the process is 121.14 kj. assuming ideal gas behavior, and neglecting kinetic and potential energy effects, determine heat transfer, in kj, and the entropy change, in kj/s. show the process on a t-s diagram.

Answers: 2

Answer

Physics, 23.06.2019 00:30

What is the relationship between wavelength of light and the quantity of energy per photon?

Answers: 2

Answer

Physics, 23.06.2019 02:00

Farmer a has a deep well and needs a lot of water for her animals and crops. her neighbor, farmer b, has a shallower well. he needs less water than farmer a because his farm is smaller. in years of drought, sometimes farmer b can't get any water from his wells. what can farmer b do to decrease the likelihood of his well running dry?

Answers: 3

Answer

You know the right answer?

Aparticular satellite with a mass of m is put into orbit around ganymede (the largest moon of jupite...

Questions