Physics, 23.08.2019 00:30 thedarcieisabelleand

How much energy is released when the correct number of protons and neutrons come together to form deuterium? a) 0.52 mev b) 1.7 mev c) 2.5 mev d) 6.1 mev e) 9.3 mev

Answers: 3

Show answers

Answers

Answer from: andrew2786

The correct answer is 2.24 MeV.

Explanation:

The chemical reaction for the formation of deuterium from proton and neutron follows:

$_{1}^1\textrm{H}+_0^1\textrm{n}\rightarrow _1^2\textrm{H}$

We are given:

Mass of $_{1}^{1}\textrm{H}$ = 1.00784 u

Mass of $_{0}^{1}\textrm{n}$ = 1.008665 u

Mass of $_{1}^{2}\textrm{H}$ = 2.014102 u

To calculate the mass defect, we use the equation:

$\Delta m=\text{Mass of reactants}-\text{Mass of products}$

$\Delta m=(m_{_1^2H}+m_{n})-(m_{_1^2H})\\\\\Delta m=(1.00784+1.008665)-(2.014102)=0.002403u$

To calculate the energy released, we use the equation:

$E=\Delta mc^2\\E=(0.002403u)\times c^2$

$E=(0.002403u)\times (931.5MeV)$ (Conversion factor: 1u=931.5MeV/c^2 )

E=2.24MeV

Hence, the energy released in the given nuclear reaction is 2.24 MeV.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Yes

Another question on Physics

Physics, 21.06.2019 17:00

Why is alternating current more effective at long–distance travel than direct current? a. the power lines are made out of conductors. b. transformers increase or decrease voltage as needed. c. the ac generator is more efficient. d. ac has lower voltage than dc.

Answers: 1

Answer

Physics, 22.06.2019 12:30

Awheel of mass 48 kg is lifted to a height of 0.8 m. how much gravitational potential energy is added to the wheel? acceleration due to gravity is g = 9.8 m/s2. a. 30.4 j b. 3.1 j c. 297.9 j d. 11,321 j

Answers: 1

Answer

Physics, 22.06.2019 13:10

A0.750 kg aluminum pan is removed from the stove and plunged into a sink filled with 10.0 kg of water at 293 k. the water temperature quickly rises to 297 k. what was the initial temperature of the aluminum pan? the specific heat of aluminum is ca = 900 j/(kgk) and water is cw = 4190 j/(kgk)

Answers: 3

Answer

Physics, 22.06.2019 19:50

State the below theories and give the name of the writer of the theory 1. wave theory 2. quantum theory 3. corpuscular theory 4. electromagnetic theory

Answers: 1

Answer

You know the right answer?

How much energy is released when the correct number of protons and neutrons come together to form de...

Questions