Physics, 29.08.2019 22:10 musicfrk2207

You spy on an anchor on the bottom of a lake. what is the direction and amount of force the water exerts on it: a) zero
b) up, equal to the weight of the anchor.
c) up, less than the weight of the anchor
d) down, equal to the weight of the anchor.

Answers: 3

Show answers

Answers

Answer from: Averybeam300

c) up, less than the weight of the anchor

Explanation:

An object floats when the weight of the water the object displaces is equal to the weight of the object. In this case the weight of the anchor and the weight of the water it displaces is not the same so it sinks. Buoyancy is the force that acts on body when it is in water.

When buoyancy is less than the force that the object is generating due to gravity the object sinks. Buoyancy always acts up.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

magnified images possible images can be real = projected onto a screen

Another question on Physics

Physics, 22.06.2019 09:30

This is important. 1. which of the following is an si base unit for measuring length? (2 points) inch gram meter mole 2. which of the following units for distance is an si unit? (2 points) centimeter foot inch yard 3. which of the following tools should a scientist use to measure an object in meters? (2 points) electronic balance pan balance tape measure thermometer

Answers: 2

Answer

Physics, 22.06.2019 13:00

At a certain instant after jumping from the airplane a, a skydiver b is in the position shown and has reached a terminal (constant) speed vb = 52 m/s. the airplane has the same constant speed va = 52 m/s, and after a period of level flight is just beginning to follow the circular path shown of radius ρa = 2330 m. (a) determine the velocity and acceleration of the airplane relative to the skydiver. (b) determine the time rate of change of the speed vr of the airplane and the radius of curvature ρr of its path, both as observed by the nonrotating skydiver.

Answers: 3

Answer

Physics, 22.06.2019 15:00

How to calculate voltage drop in a series circuit

Answers: 1

Answer

Physics, 23.06.2019 00:30

Due in 40 explain in terms of frame of reference if you’re inside a moving train everything on the outside can seem to be moving

Answers: 1

Answer

You know the right answer?

You spy on an anchor on the bottom of a lake. what is the direction and amount of force the water ex...