Physics, 30.09.2019 14:30 dxpebetty64

1. identify each of the following as conductors or insulators.

19. cloth

20. dry wood

21. tap water

22. glass

2. light passes from air into water at an angle of 40.0° to the normal. what is the angle of refraction? show all work.

3. a rubber rod can be charged negatively when it is rubbed with wool. what happens to the charge of the wool?

4. what is electrical power in terms of current and potential difference?

5. generate an explanation for the following formula: p = i2r

6. three 15.0-w resistors are connected in parallel across a 30.0-v battery. show all work.

a) find the current through each branch of the circuit.

b) find the equivalent resistance of the circuit.

c) find the current through the battery.

7. what happens to the polarity of an electromagnet when the direction of the current passing through it is reversed?

Answers: 1

Show answers

Answers

Answer from: Quest

Answer:

the word that best describes martin luther king jr.'s tone in the video is dignified

explanation:

martin luther king, jr. was a social activist and baptist minister who played a key role in the american civil rights movement from the mid-1950s until his assassination in 1968. the video shows his manner and attitude having or showing a composed or serious manner that is worthy of respect so dignified is the correct answer

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

no. dot product =0 when vecs at right angles

Answer from: Quest

the minimum constant speed at which she can catch the train is 2.7 m/s

given:

acceleration = 0.6 $\frac{m}{s^{2} }$

time = 4.5 s

to find:

velocity = ?

formula used:

from 1st kinematic equation we get,

v = u + at

u = initial speed of train = 0 m/s

v = final speed of the train

a = acceleration of the train

t = time

solution:

from 1st kinematic equation we get,

v = u + at

u = initial speed of train = 0 m/s

v = final speed of the train

a = acceleration of the train

t = time

v = 0 + (0.6 × 4.5)

v = 2.7 m/s

the minimum constant speed at which she can catch the train is 2.7 m/s

Another question on Physics

Physics, 22.06.2019 06:30

Alead ball is dropped into a lake from a diving board 5m above the water . it hits the water with a certain velocity and then sink with constant velocity in bottom . it reaches the bottom 5 second after it is dropped if g= 10m/s2 . find depth of the lake and average velocity of the ball ?

Answers: 1

Answer

Physics, 22.06.2019 06:30

At very high pressures, gases become and will eventually a) more dense; become hotter b) more dense; change to a liquid or solid c) less dense; combust d) less dense; turn into a liquid

Answers: 1

Answer

Physics, 22.06.2019 14:00

Which body part transports oxygen removes waste materials in carries nutrients to the body as part of the circulatory system

Answers: 1

Answer

Physics, 22.06.2019 14:40

A5 foot by 5 foot box culvert is buried 6 feet beneath the surface of the ground. a crosssection of this very long culvert (into and out of the page) is illustrated below. assume that the soil in which the culvert is buried has the following properties: jt = 120 pcf, w = 12%, ko = 0.50, ka = 0.33, and kp = 3.00. calculate the total horizontal force per unit length of culvert (fh) felt on one of the vertical faces of the culvert.

Answers: 1

Answer

You know the right answer?

1. identify each of the following as conductors or insulators.

19. cloth

20. d...

Questions