Physics, 30.10.2019 06:31 lovedavis9544

Aslender rod is 80.0 cm long and has mass 0.290 kg. a small 0.0200 kg sphere is welded to one end of the rod, and a small 0.0500 kg sphere is welded to the other end. the rod, pivoting about a stationary, frictionless axis at its center, is held horizontal and released from rest. what is the linear speed of the 0.0500 kg sphere as it passes through its lowest point?

Answers: 2

Show answers

Answers

Answer from: DESI111609

V= 1.2m/s

Explanation:

Since both spheres fall to an equidistant center, both spheres travel a distance of 0.4m

This is:

The 0.05kg sphere falls 0.4m while the 0.02kg sphere goes up 0.4m

The decrease in Potential Energy is given by:

$\Delta PE = (m2-m1) * g * h = (0.05-0.02) * 9.8 * 0.4 = 0.1176 J$

The moment of inertia for the entire system is given by:

$I = \frac{mL ^ 2}{12}+(m1 + m2) (\frac{L}{2} )^2$

I = 0.290kg * (0.8m) ^ 2/12 + 0.07kg * (0.4m)^2 = 0.026Kg * m^2

In this way the kinetic energy is given by

$KE = \frac{1}{2} Iw^2$

$0.1176J = \frac{1}{2}* 0.026Kg *m^2 * w^2$

w = 3 rad / s

v = wr = 3 * 0.4 = 1.2m / s

Answer from: Quest

the answer is neither ball has a charge.

because if they were both positively charged, they will repel each other.

if they were positively and negatively charged, they will seek.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 20.06.2019 18:04

Agenerator converts mechanical energy to electrical energy. when a coil placed between two magnets rotates, the magnetic lines of force are disturbed. this induces a current in the coil. the image below shows a generator. what could be done to make the lamp brighter? a. decrease the size of the magnets b. turn the coil slower c. change the polarity of the magnets d. turn the coil faster

Answers: 3

Answer

Physics, 21.06.2019 18:20

The extremely high temperatures needed to trigger nuclear fusion are proposed to be generated by laser irradiating a spherical pellet of deuterium and tritium fuel of diameter 1.8 mm. (a) determine the maximum fuel temperature that can be achieved by irradiating the pellet with 200 lasers, each producing a power of 550 w. the pellet has an absorptivity 0.3 and emissivity 0.8.

Answers: 2

Answer

Physics, 21.06.2019 19:00

What term do psychologists use to designate our personal awareness of feelings, sensations, and thoughts?

Answers: 1

Answer

Physics, 21.06.2019 20:50

What is the type of the reaction below? bacl2 + h2so4 → 2 hci + baso4 double replacement synthesis single replacement decomposition

Answers: 1

Answer

You know the right answer?

Aslender rod is 80.0 cm long and has mass 0.290 kg. a small 0.0200 kg sphere is welded to one end of...