Physics, 21.11.2019 21:31 kalithekittenqueen

As you go above earths surface, the acceleration due to gravity will decrease. find the height, i meters, above the earths surface where this value will be 1/410g

Answers: 1

Show answers

Answers

Answer from: biaxialpower789

1.23×10⁸ m

Explanation:

Acceleration due to gravity is:

a = GM / r²

where G is the universal gravitational constant,

M is the mass of the planet,

and r is the distance from the center of the planet to the object.

When the object is on the surface of the Earth, a = g and r = R.

g = GM / R²

When the object is at height i above the surface, a = 1/410 g and r = i + R.

1/410 g = GM / (i + R)²

Divide the first equation by the second:

g / (1/410 g) = (GM / R²) / (GM / (i + R)²)

410 = (i + R)² / R²

410 R² = (i + R)²

410 R² = i² + 2iR + R²

0 = i² + 2iR − 409R²

Solve with quadratic formula:

i = [ -2R ± √((2R)² − 4(1)(-409R²)) ] / 2(1)

i = [ -2R ± √(1640R²) ] / 2

i = (-2R ± 2R√410) / 2

i = -R ± R√410

i = (-1 ± √410) R

Since i > 0:

i = (-1 + √410) R

R = 6.37×10⁶ m:

i ≈ 1.23×10⁸ m

Answer from: Quest

as technology advances, new experiments often expose problems in accepted theories. c

hope i

-lavira: )

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 17:30

What is the relationship between the wavelength of a wave and it's energy?

Answers: 1

Answer

Physics, 21.06.2019 18:10

Achild throws a ball with an initial speed of 8.00 m/s at an angle of 40.0° above the horizontal. the ball leaves her hand 1.00 m above the ground. how long is the ball in flight before it hits the ground?

Answers: 1

Answer

Physics, 22.06.2019 03:30

Aplane flies a distance d from west to east at a constant speed vp , with respect to the air in a time twe . on the return trip, the plane flies a distance d from east to west at a constant speed vp , with respect to the air in a time tew . on both trips the wind blows from west to east at a constant speed va , with respect to the ground 1) what is tew in terms of vp, va, and d, as needed? tew=dvp tew=dvp+va tew=dva tew=dvpâ’va tew=12dvp tew=12dvp+va tew=12dvpâ’va your submissions: b submitted: saturday, january 26 at 6: 49 pm feedback: feedback will be given once all questions have been attempted and the grade cluster button has been pressed. 2) what is twe in terms of vp, va, and d, as needed? twe=dvp twe=dvp+va twe=dva twe=dvpâ’va twe=12dvp twe=12dvp+va twe=12dvpâ’va your submissions: d submitted: saturday, january 26 at 6: 49 pm feedback: feedback will be given once all questions have been attempted and the grade cluster button has been pressed. 3) assuming d = 2300 miles, vp = 400 miles/hr, and twe = 4 hours, what is va, the speed of the wind with respect to the ground? va = 100 miles/hr va = 575 miles/hr va = 200 miles/hr va = 175 miles/hr va = 975 miles/hr 4) once again, assuming d = 2300 miles, vp = 400 miles/hr, and twe = 4 hours, what is tew, the time it takes the plane to fly a distance d miles from east to west? tew = 5.75 hours tew = 11.5 hours tew = 7.67 hours tew = 8 hours tew = 10.2 hours

Answers: 2

Answer

Physics, 22.06.2019 09:00

As a pendulum bob swings back and forth several times, the maximum height it reaches becomes less and less. this is because more and more of the pendulum bob's energy is being transformed into a. heat energy b. kinetic energy c. potential energy d. kinetic energy and potential energy

Answers: 2

Answer

You know the right answer?

As you go above earths surface, the acceleration due to gravity will decrease. find the height, i me...

Questions