Physics, 10.12.2019 22:31 deonnaturner68p7hz7y

How does the force the earth exerts on you compare with the force you exert on it?

a. earth exerts a larger force on you.
b. you exert a larger force on earth.
c. earth and you exert equal and opposite forces on each other.

Answers: 1

Show answers

Answers

Answer from: infoneetusinghoyg22o

C.Earth and you exert equal and opposite forces on each other.

Explanation:

Hello, I can help you with this

The force that the earth exerts on any object is due to the force of gravity and is known as weight, F = mg, this force is directed towards the center of the earth, in addition, according to the laws of physics for any action must have a reaction, in this case it is a force that goes out from the ground and it is directed upwards, this force is called normal and it has the same magnitude of your weight but the opposite direction.

Have a great day.

Answer from: Quest

there are no correct statementd on the list of choices you provided.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 22:40

Consider two metallic rods mounted on insulated supports. one is neutral, the other positively charged. you bring the two rods close to each, but without contact, and briefly ground the the neutral rod by touching it with your hand. show answer correct answer what would be resulting charge (if any) on the initially neutral rod

Answers: 1

Answer

Physics, 22.06.2019 13:30

6–48 bananas are to be cooled from 24 to 138c at a rate of 215 kg/h by a refrigeration system. the power input to the refrigerator is 1.4 kw. determine the rate of cooling, in kj/ min, and the cop of the refrigerator. the specific heat of banana above freezing is 3.35 kj/kg·8c.

Answers: 3

Answer

Physics, 22.06.2019 14:30

Which of the following changes will increase the capacitance of a parallel-plate capacitor? (there could be more than one correct choice.) a) increase the charge on the plates b) decrease the poten5al between the plates c) increase the potential between the plates d) introduce a dielectric material between the plates e) decrease the separation between the plates

Answers: 3

Answer

Physics, 22.06.2019 16:00

The electric potential a distance r from a small charge is proportional to what power of the distance from the charge? a. r^-1 b. r c. r^-2 d. r^2

Answers: 1

Answer

You know the right answer?

How does the force the earth exerts on you compare with the force you exert on it?

a....

Questions