Physics, 14.01.2020 00:31 Teddybearnerd

Which change will always result in an increase in the gravitational force between two objects?
increasing the masses of the objects and increasing the distance between the objects
decreasing the masses of the objects and decreasing the distance between the objects
increasing the masses of the objects and decreasing the distance between the objects
decreasing the masses of the objects and increasing the distance between the objects

Answers: 3

Show answers

Answers

Answer from: monk68

Increasing the masses of the objects and decreasing the distance between the objects.

Explanation:

Gravitational force always act between two objects that have mass. The gravitational force is a weak force and attractive in nature.

The force of pull depends on the masses of the two objects and the distance between them.

The formula to calculate gravitational force between two objects having masses 'm' and 'M' and separated by a distance 'd' is given as:

$F_g=\frac{GmM}{d^2}$

Where, 'G' is called the universal gravitational constant.

Now, from the above formula, it is clear that, the force of gravitation is inversely proportional to the square of the distance between the two objects and directly proportional to the masses of the two objects.

This means that, if masses increase with other parameters constant, force will increase and vice-versa. If distance decreases with other parameters constant, force will increase and vice-versa.

So, on combining the above two relations,we are certain that if one increases the masses and decrease the distance between, the gravitational force will definitely increase.

So, the third option is correct.

Answer from: Quest

electric

explanation:

Which type of heating system is used to heat many buildings from a central location?

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 23:20

In the sport of parasailing, a person is attached to a rope being pulled by a boat while hanging from a parachute-like sail. a rider is towed at a constant speed by a rope that is at an angle of 15 ∘ from horizontal. the tension in the rope is 1900 n. the force of the sail on the rider is 30∘ from horizontal. what is the weight of the rider? express your answer with the appropriate units.

Answers: 1

Answer

Physics, 21.06.2019 23:50

Any color picture tube and electric field exerts a net force of magnitude 1.68x 10^-13 n on an electron the rest mass of an electron is 9.11 x 10^-13 what is the electron acceleration?

Answers: 3

Answer

Physics, 22.06.2019 07:50

Calculate the ratio of h+ ions to oh– ions at a ph = 6. find the concentration of h+ ions to oh– ions listed in table b of your student guide. then divide the h+ concentration by the oh– concentration. record this calculated ratio in table a of your student guide. compare your approximated and calculated ratios of h+ ions to oh– ions at a ph = 6. are they the same? why or why not? record your explanation in table a. what is the concentration of h+ ions at a ph = 6? mol/l what is the concentration of oh– ions at a ph = 6? mol/l what is the ratio of h+ ions to oh– ions at a ph = 6? : 1

Answers: 1

Answer

Physics, 22.06.2019 14:10

The number of passengers who arrive at the platform of a subway station for the 10 am train is a random variable with a mean of 120 and a variance of 16. find the lower bound of the probability that there will be between 100 and 140 passengers (round off to second decimal place).

Answers: 3

Answer

You know the right answer?

Which change will always result in an increase in the gravitational force between two objects?

Questions