Physics, 23.01.2020 05:31 memos5502

what facts about energy can be inferred from the image? check all that apply.

Answers: 2

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Answer

the order for strong to weak forces such as

strong nuclear force → electromegnetic force → weak nuclear force → gravitational force

explanation

the fundamental forces are those forces that act between to objects or element to make interactions. there are four types of fundamental forces such as strong and weak nuclear forces (due to protons and electrons), electromagnetic force (due to the motion of electrons) and gravitational force (due to orbital movement of the planet). if these forces are arranged on the basis of their maximum strength then the order is

strong nuclear force → electromegnetic force → weak nuclear force → gravitational force

Answer from: Quest

Go to the bathroom and vape

Answer from: Quest

It maybe because uranus is made of gas but uranus has a solid core in the middle

Another question on Physics

Physics, 21.06.2019 15:30

Match the atomic particles with their characteristics. 1. made of two protons and two neutrons neutron 2. similar to an electron; positive charge neutrino 3. orbits nucleus; negative charge positron 4. bundle of energy; zero charge proton 5. found in nucleus; positive charge meson 6. very unstable; +, -, or zero charge gamma 7. found in nucleus; zero charge electron 8. negative particle; negative charge beta 9. atomic energy converted to mass alpha

Answers: 1

Answer

Physics, 22.06.2019 14:20

How many atoms of nitrogen are in the chemical formula ni(w on

Answers: 1

Answer

Physics, 22.06.2019 14:30

When the displacement of a mass on a spring is 12a the half of the amplitude, what fraction of the mechanical energy is kinetic energy? at what displacement, as a fraction of a, is the mechanical energy half kinetic and half potential?

Answers: 3

Answer

Physics, 22.06.2019 19:30

The nuclear potential that binds protons and neutrons in the nucleus of an atom is often approximated by a square well. imagine a proton conned in an innite square well of length 105 nm, a typical nuclear diameter. calculate the wavelength and energy associated with the photon that is emitted when the proton undergoes a transition from the rst excited state (n 2) to the ground state (n 1). in what region of the electromagnetic spectrum does this wavelength belong?

Answers: 1

Answer

You know the right answer?

what facts about energy can be inferred from the image? check all that apply....

Questions