Physics, 28.01.2020 06:31 TerrieRichard8405

While riding in a moving car, you toss an egg directly upward. does the egg tend to land behind you, in front of you, or back in your hands if the car is

(a) traveling at a constant speed,
(b) increasing in speed, and
(c) decreasing in speed

Answers: 3

Show answers

Answers

Answer from: LindaCat78

a) In the hand

b) behind the hand

c) in front of the hand

Explanation:

When traveling at a constant speed when an egg is tossed directly upwards it lands back in our hand. It is so because the instant when the egg is released from the hand the egg has the same velocity as the velocity of the person sitting in the moving car, and hence by the virtue of inertia of motion it land lands back in our hand.

When we toss an egg while the car is accelerating then the egg lands behind the hand because the hand along with the car is accelerating ahead. The instant when the egg is released from the hand the car is accelerating then the car has a lower velocity which the egg acquires in the air, while the egg is in the air the car further gains the velocity and hence the egg lands behind the hand.

When the speed of the car is decreasing then the egg lands in front of the hand because the moment when the egg was tossed into the air it acquired the instantaneous velocity of the car from that moment and then while it was in the air it had the same velocity as initial while the car further decelerated.

Answer from: Quest

c, 1a hope this

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 19:30

Asun-sized star will spend most of its lifetime as a: white dwarf red giant protostar main-sequence star

Answers: 1

Answer

Physics, 21.06.2019 23:00

How are calculation for velocity and speed different

Answers: 1

Answer

Physics, 22.06.2019 15:30

Two point charges are separated by a certain distance. how does the strength of the electric field produced by the first charge, at the position of the second charge, change if the second charge is doubled? a. the field does not change b. the field strength decreases by half. c. the field strength doubles d. the field strength quadruples

Answers: 1

Answer

Physics, 22.06.2019 17:10

The particles that are found in the nucleus of an atom are

Answers: 1

Answer

You know the right answer?

While riding in a moving car, you toss an egg directly upward. does the egg tend to land behind you,...

Questions