Physics, 18.02.2020 03:27 babygirl1780

An airplane flies due north at 225 km/h relative to the air. There is a wind blowing at 60 km/h to the northeast relative to the ground. What are the plane's speed and direction relative to the ground?

Answers: 1

Show answers

Answers

Answer from: pr47723

270.78 m/s and 9 degrees north of east

Explanation:

Suppose that the wind direction is 45 degree relative to the eastern direction. Let east and north be the positive horizontal ( $\hat{i}$ ) and vertical ( $\hat{j}$ ) directions here. We can calculate the horizontal and vertical components of wind velocity

v_v = v_h = 60 cos45^0 = 60*0.707 = 42.43 km/h

The velocity of the wind can be rewritten as the following

$\vec{v_w} = 42.43 \hat{i} + 42.43 \hat{j}$

The velocity of the airplane that is 225 km/h due north is

$\vec{v_a} = 225 \hat{j}$

The plane velocity relative to the ground is its velocity relative to the wind plus the wind velocity relative to the ground

$\vec{v} = \vec{v_w} + \vec{v_a} = 42.43 \hat{i} + 42.43 \hat{j} + 225 \hat{j} = 42.43 \hat{i} + 267.43 \hat{j}$

The magnitude and direction of this velocity vector can be calculated

$v = \sqrt{v_x^2 + v_y^2} = \sqrt{42.43^2 + 267.43^2} = \sqrt{1800.3049 + 71518.8049} = \sqrt{73319.1098} = 270.78$

$tan\alpha = \frac{v_x}{v_y} = \frac{42.43}{267.43} = 0.16$

$\alpha = tan^{-1}0.16 = 0.16 rad \approx 9.02 degrees$ north of east

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Rain is pulled by gravity which is a non contact force

Another question on Physics

Physics, 22.06.2019 16:00

The electric field direction is defined by the direction of the force felt by (select one of the following answers): 1. a negative charge. 2. a positive charge. 3. both positive and negative charges.

Answers: 2

Answer

Physics, 22.06.2019 16:00

At what time will the interfering waves have an amplitudeof zero?

Answers: 1

Answer

Physics, 22.06.2019 17:50

Which of the following best describes internal energy? a. the difference between the kinetic and potential energies of the particles in a system b. the sum of the kinetic and potential energies of the particles in a system c. the sum of the kinetic and thermal energies of the particles in a system d. the difference between the kinetic and thermal energies of the particles in a system

Answers: 2

Answer

Physics, 22.06.2019 19:30

What you see with your eyes is a form of energy. a. light b. heat c. chemical d. electrical

Answers: 2

Answer

You know the right answer?

An airplane flies due north at 225 km/h relative to the air. There is a wind blowing at 60 km/h to t...

Questions