Physics, 07.03.2020 04:31 aaronjin4443

A coin is placed 12.0 cm from the axis of a rotating turntable of variable speed. When the speed of the turntable is slowly increased, the coin remains fixed on the turntable until a rate of 37.0 rpm (revolutions per minute) is reached, at which point the coin slides off.

Answers: 3

Show answers

Answers

Answer from: Serenitybella

Explanation:

For the given situation,

Frictional force = centripetal force

$\mu mg = m \omega^{2}r$

Cancel out the common terms, we get

$\mu = \frac{\omega^{2}r}{g}$

= $\frac{(3.87)^{2} \times 0.12 m}{9.8}$ (as 1 rpm = 0.10472 rad/sec)

= $\frac{1.797}{9.8}$

= 0.183

thus, we can conclude that coefficient of static friction in the given situation is 0.183.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

massxgravity x heght=weightxheight= pe

4900=490xh

h=10

Another question on Physics

Physics, 22.06.2019 02:30

The boy of mass 30 kg is at r1= 2 meters from the fulcrum. of the girl is 45 kg, at what r2 must she sit so that they are balanced ?

Answers: 3

Answer

Physics, 22.06.2019 04:30

Asystem containing an ideal gas at a constant pressure of 1.22×10^5 pa gains 2140 j of heat. during the process, the internal energy of the system increases by 2320 j. what is the change in volume of the gas?

Answers: 3

Answer

Physics, 22.06.2019 09:00

Infrared rays have a shorter wavelength than question 11 options: x-rays. ultraviolet rays. radio waves. gamma rays.

Answers: 1

Answer

Physics, 22.06.2019 16:30

In the nineteenth century, gregor mendel first determined some basic rules of genetics that have been observed throughout all types of life. no observations have disproved these basic rules of genetics. charles darwin developed the idea of biological evolution around the same time, but he was unaware of mendel’s discoveries in genetics. over a century later, darwin’s idea of evolution was modified in order to incorporate mendel’s rules of genetics along with the other evidence that darwin had used. what is most likely the relationship between mendel’s rules of genetics and darwin’s idea of biological evolution? a.)mendel’s genetics states laws that are now part of the theory of biological evolution.b.)biological evolution states laws that are part of mendel’s theory of genetics.c.)mendel’s genetics replaced darwin’s entire concept of biological evolution.d.)biological evolution is a law that explains why all genetics exist.

Answers: 1

Answer

You know the right answer?

A coin is placed 12.0 cm from the axis of a rotating turntable of variable speed. When the speed of...

Questions