Physics, 16.03.2020 17:56 bethanybowers4986

A long wire carrying a 5.0 A current perpendicular to the xy-plane intersects the x-axis at x= - 2.0 cm . A second, parallel wire carrying a 3.5 A current intersects the x-axis at x=+ 2.0cm .

A). At what point on the x-axis is the magnetic field zero if the two currents are in the same direction?

B). At what point on the x-axis is the magnetic field zero if the two currents are in opposite directions?

Answers: 2

Show answers

Answers

Answer from: SweetBriar

(A) The currents are flowing in same direction and distance from zero magnetic field point is 0.35 cm.

(B) The currents are in opposite directions the point on x-axis is 11.33 cm.

Given data:

The magnitude of current in the wire is, I = 5.0 A.

The intersecting distance is, x' = -2.0 cm.

Magnitude of current in second wire is, I' = 3.5 A.

Intersecting distance from second wire is, x'' = +2.0 cm.

(A)

Since, both currents are in the same direction, the null point lies in between them. Let x be distance of N from first wire, then distance from 2nd wire is 4-x

So, For the magnetic fields to be zero, the fields of both wires should be equal and opposite. Then,

$\dfrac{\mu_{0} \times I}{2 \pi x}=\dfrac{\mu_{0} \times I'}{2 \pi (4 - x)}\\\\\\\dfrac{\mu_{0} \times I}{2 \pi x}=\dfrac{\mu_{0} \times I'}{2 \pi (4 - x)}\\\\\\\dfrac{I}{x}=\dfrac{I'}{(4 - x)}\\\\\\\dfrac{5}{x}=\dfrac{3.5}{(4 - x)}\\\\x =2.35 \;\rm cm$

So, point at which the magnetic field is zero is,

n = x - x'

n = 2.35 - 2.0

n = 0.35 cm

Thus, we can conclude that the currents are flowing in same direction and distance from zero magnetic field point is 0.35 cm.

(B)

Given both currents flow in opposite directions, the null point lies on the other side. Then the calculation is,

$\dfrac{\mu_{0} \times I}{2 \pi x}=\dfrac{\mu_{0} \times I'}{2 \pi (4 +x)}\\\\\\\dfrac{\mu_{0} \times I}{2 \pi x}=\dfrac{\mu_{0} \times I'}{2 \pi (4 +x)}\\\\\\\dfrac{I}{x}=\dfrac{I'}{(4+x)}\\\\\\\dfrac{5}{x}=\dfrac{3.5}{(4 + x)}\\\\x =9.33 \;\rm cm$

So, point at which the magnetic field is zero is,

n = x + x'

n = 9.33 + 2.0

n = 11.33 cm

Thus, we can conclude that the currents are in opposite directions the point on x-axis is 11.33 cm.

Learn more about the magnetic effect of current here:

link

Answer from: maddynichole2017

a . 0.35cm

b. 11.33cm

Explanation:

a. Given both currents are in the same direction, the null point lies in between them. Let x be distance of N from first wire, then distance from 2nd wire is 4-x

#For the magnetic fields to be zero,the fields of both wires should be equal and opposite.They are only opposite in between the wires:

$\frac{\mu_oi_1}{2\pi x}=\frac{\mu_oi_2}{2\pi(4-x)}\\\\5/x=\frac{3.5}{4-x}\\\\x=2.35cm\\\\N=2.35-2=0.35cm$

Hence, for currents in same direction, the point is 0.35cm

b. Given both currents flow in opposite directions, the null point lies on the other side.

#For the magnetic fields to be zero,the fields of both wires should be equal and opposite.They are only opposite in outside the wires:

Let x be distance of N from first wire, then distance from 2nd wire is 4+x:

$\frac{\mu_oi_1}{2\pi(4+ x)}=\frac{\mu_oi_2}{2\pi x}\\\\5/(4+x)=\frac{3.5}{x}\\\\x=9.33cm\\\\N=9.33+2=11.33cm$

Hence, if currents are in opposite directions the point on x-axis is 11.33cm

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

answer: 2×10^-2kg

explanation: density= mass per volume

vol=mass/density

converting to s.i units we have;

3÷1000kg = 0.003

1.5÷100m = 0.15

0.003/0.15 = 0.02kg

Another question on Physics

Physics, 22.06.2019 08:30

Hey student studies gravity using objects that have the same mass which two objects have the greatest gravitational force acting between them a. 100kg 1.0m 100kg b. 100kg 2.0m 100kg c. 100kg 2.0m 100kg big d. 100kg big 3.0m 100kg big

Answers: 1

Answer

Physics, 22.06.2019 22:30

Find v1, the speed of the fluid in the left end of the main pipe. express your answer in terms of h1, h2, g, and either a1 and a2 or γ, which is equal to a1a2.

Answers: 2

Answer

Physics, 23.06.2019 08:00

The cheetah is considered the fastest running animal in the world. cheetahs can accelerate to a speed of 20.1 m/s in 2.50 s and can continue to accelerate to reach a top speed of 28.1 m/s. assume the acceleration is constant until the top speed is reached and is zero thereafter.1) starting from a crouched position, how long does it take a cheetah to reach its top speed? (express your answer to three significant figures.) s2) how far does it travel in that time? (express your answer to three significant figures.) m3) if a cheetah sees a rabbit 120 m away, how long will it take to reach the rabbit, assuming the rabbit does not move? (express your answer to three significant figures.)

Answers: 3

Answer

Physics, 23.06.2019 09:00

Which atomic model is missing from this set

Answers: 3

Answer

You know the right answer?

A long wire carrying a 5.0 A current perpendicular to the xy-plane intersects the x-axis at x= - 2.0...

Questions