Physics, 25.03.2020 06:25 emilybutler

Having difficulty finding the PE and KE for these values no mass is given. Does anyone know to go solve these?

Having difficulty finding the PE and KE for these values no mass is given. Does anyone know to go so

Answers: 3

Show answers

Answers

Answer from: aaronlikly

11) $1.04\cdot 10^7 J$

12) $1.04\cdot 10^7 J$

13) 50.0 m/s

14) 41.6 m/s

Explanation:

11)

The potential energy of an object is the energy possessed by the object due to its position relative to the ground. It is given by

PE=mgh

where

m is the mass of the object

g is the acceleration due to gravity

h is the height relative to the ground

Here in this problem, when the train is at the top, we have:

m = 8325 kg (mass of the train + riders)

g=9.8 m/s^2 (acceleration due to gravity)

h = 127 m (height of the train at the top)

Substituting,

$PE=(8325)(9.8)(127)=1.04\cdot 10^7 J$

12)

According to the law of conservation of energy, the total mechanical energy of the train must be conserved (in absence of friction). So we can write:

KE_t + PE_t = KE_b + PE_b

where

KE_t is the kinetic energy at the top

PE_t is the potential energy at the top

KE_b is the kinetic energy at the bottom

PE_b is the potential energy at the bottom

The kinetic energy is the energy due to motion; since the train is at rest at the top, we have

KE_t=0

Also, at the bottom the height is zero, so the potential energy is zero

PE_b=0

Therefore, we find:

$KE_b=PE_t=1.04\cdot 10^7 J$

13)

The kinetic energy of an object is the energy of the object due to its motion. Mathematically, it is given by

$KE=\frac{1}{2}mv^2$

where

m is the mass of the object

v is the speed of the object

From question 12), we know that the kinetic energy of the train at the bottom is

$KE=1.04\cdot 10^7 J$

We also know that the mass is

m = 8325 kg

Therefore, we can calculate the speed of the train at the bottom:

$v=\sqrt{\frac{2KE}{m}}=\sqrt{\frac{2(1.04\cdot 10^7)}{8325}}=50.0 m/s$

14)

At the top of the second hill, the total mechanical energy of the train is still conserved.

Therefore, we can write again:

KE_1 + PE_1 = KE_2 + PE_2

where

KE_1 is the kinetic energy at the top of the 1st hill

PE_1 is the potential energy at the top of the 1st hill

KE_2 is the kinetic energy at the top of the 2nd hill

PE_2 is the potential energy at the top of the 2nd hill

From the previous questions, we know that

KE_1=0

and

$PE_1=1.04\cdot 10^7 J$

The height of the second hill is

h = 39 m

So we can also find the potential energy at the second hill:

$PE_2=mgh=(8325)(9.8)(39)=3.2\cdot 10^6 J$

So, the kinetic energy at the second hill is

$KE_2=PE_1-PE_2=1.04\cdot 10^7 - 3.2\cdot 10^6 =7.2\cdot 10^6 J$

And so, the speed is

$v=\sqrt{\frac{2KE_2}{m}}=\sqrt{\frac{2(7.2\cdot 10^6)}{8325}}=41.6 m/s$

Answer from: Quest

Learned about life itself

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 17:30

Abaseball picther can throw a ball at about 90 miles per hour, v = 40 m/s, on solid rock ground. we now put him into space. when he throws the ball, which weighs mb = 0.15 kg moves away from himat the same speed. how long does it take the ball thrown in space to travel the 30 meters to the batter? he weighs mp = 100kg

Answers: 1

Answer

Physics, 22.06.2019 22:30

An alarm clock has a current of 4.5 amps and a resistance of 3.2 ohms. what is the voltage in the circuit? a.1.4 volts b.0.71 volts c.14 volts d.46 volts

Answers: 2

Answer

Physics, 23.06.2019 00:00

You are a researcher for a golf club manufacturer. you are given two identical looking cubes of a metal alloy. you are informed that they are made of the exact same material, but one is crystalline, whereas the other is amorphous. it is your job to determine which one is amorphous this one is more stress-resistant and is useful in reinforcing golf clubs. which of the following is the best way to determine which is which? a. determine the density of each cube. the more dense one is the amorphous solid. b. melt both cubes and look for a broader range of melting temperatures. the one that melts over a broader range of temperatures is the amorphous solid. c. determine the density of each cube. the less dense cube is the amorphous solid. d. melt both cubes and measure the range of melting temperatures. the one that melts over a narrower range of temperatures is the amorphous solid.

Answers: 1

Answer

Physics, 23.06.2019 00:30

1. when conducting a test on what kind of music increases the growth of plants, all of the following would fail to meet to fair test standard except (1 point) using different kinds of plants. giving some plants more water than others. exposing the plants to different types of music. using nutrient-rich soil for one and lesser soil for others. 2. engineering uses scientific thinking to solve real-world problems. (1 point) true false 3. what does it mean to test a hypothesis? (1 point) pass a quiz on other scientists’ results analyze only the results from scientific sources not make assumptions about how an experiment will turn out see if the results of an experiment are what the scientist predicted

Answers: 3

Answer

You know the right answer?

Having difficulty finding the PE and KE for these values no mass is given. Does anyone know to go so...

Questions