The law of universal gravitation states that any two objects in the universe, without exception,

a) attract each other.

b) repel each other.

c) combine to provide a balanced force.

d) create friction.

The law of universal gravitation states that any two objects in the universe,
without exception, attract each other.

When you think about it, that means that there is a force of attraction
between the lint at the bottom of your pocket and the smallest grain
of sand on the beach on the other side of the farthest planet of the
farthest star in the farthest galaxy on the other side of the universe
from us.  The force is too small to measure, but it can be calculated.

Attract to each other. Think of how Earth is constantly attracted to the sun. We are pulled by it's gravity. The moon is pulled by Earths gravity and the suns unintentionally. The moon being pulled partially by the suns gravity keeps it from crashing into us.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Show him another sport or something