Physics, 19.05.2020 20:15 webbjalia04

What is the continuous flow of electric charge?
voltage
resistance
potential difference
current

Answers: 2

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

d₁ = displacement of tern from arctic to antarctic = 11000 miles

d₂ = displacement of tern from antarctic to arctic = - 11000 miles

d = total displacement for the journey

total displacement for the journey is given as

d = d₁ + d₂

d = 11000 + (-11000)

d = 0 miles

t₁ = time of travel from arctic to antarctic = 3 months = 3 x 30 days = 90 days

t₂ = time of travel from antarctic to arctic = 3 months = 3 x 30 days = 90 days

t = total time of travel

total time of travel is given as

t = t₁ + t₂

t = 90 + 90

t = 180 days

average velocity is given as

average velocity = total displacement/ total time

v = d/t

v = 0/180

v = 0 miles/day

Answer from: Quest

The answer is b hope this

Answer from: Quest

No because a circle or pie graph usually shows percentages you'd need a line graph

Another question on Physics

Physics, 21.06.2019 20:30

Air enters a compressor operating at steady state at 1.05 bar, 300 k, with a volumetric flow rate of 93 m3/min and exits at 12 bar, 400 k. heat transfer occurs at a rate of 15.5 kw from the compressor to its surroundings. assuming the ideal gas model for air neglecting kinetic potential energy effects, determine the power in put in kw.

Answers: 2

Answer

Physics, 22.06.2019 12:30

Write a full page that sumerizes thermodynamics it’s from the website visionlearnig

Answers: 1

Answer

Physics, 22.06.2019 16:30

The ph is the a.independent variable b.the dependent variable c.control group

Answers: 1

Answer

Physics, 22.06.2019 16:50

Two loudspeakers, 5.5 m apart and facing each other, play identical sounds of the same frequency. you stand halfway between them, where there is a maximum of sound intensity. moving from this point toward one of the speakers, you encounter a minimum of sound intensity when you have moved 0.33 m . assume the speed of sound is 340 m/s.part a) what is the frequency of the sound? part b) if the frequency is then increased while you remain 0.21 m from the center, what is the first frequency for which that location will be a maximum of sound intensity? express your answer to two significant figures and include the appropriate units.

Answers: 2

Answer

You know the right answer?

What is the continuous flow of electric charge?
voltage
resistance
potential diffe...

Questions