Physics, 05.07.2020 14:01 ashleytorrao65541

A 1.20 kg water balloon will break if it experiences more than 530 N of force. Your 'friend' whips the water balloon toward you at 13.0 m/s. The maximum force you apply in catching the water balloon is twice the average force. How long must the interaction time of your catch be to make sure the water balloon doesn't soak you

Answers: 1

Show answers

Answers

Answer from: danielapenaoypgns

t = 0.029s

Explanation:

In order to calculate the interaction time at the moment of catching the ball, you take into account that the force exerted on an object is also given by the change, on time, of its linear momentum:

$F=\frac{\Delta p}{\Delta t}=m\frac{\Delta v}{\Delta t}$ (1)

m: mass of the water balloon = 1.20kg

Δv: change in the speed of the balloon = v2 - v1

v2: final speed = 0m/s (the balloon stops in my hands)

v1: initial speed = 13.0m/s

Δt: interaction time = ?

The water balloon brakes if the force is more than 530N. You solve the equation (1) for Δt and replace the values of the other parameters:

$|F|=|530N|= |m\frac{v_2-v_1}{\Delta t}|\\\\|530N|=| (1.20kg)\frac{0m/s-13.0m/s}{\Delta t}|\\\\\Delta t=0.029s$

The interaction time to avoid that the water balloon breaks is 0.029s

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the answer is mosques. they are an important part of islamic culture.

Another question on Physics

Physics, 22.06.2019 06:40

Alinearly polarized electromagnetic wave has an average intensity of 196 w/m^2. this wave is directed towards two ideal polarizers (in real polarizers, transmission is also effected by reflection and absorption). polarizer a is oriented with its transmission axis at an angle of θ_1=20.8∘ with the incident electric field. polarizer b has its axis at an angle of θ_2=63.0∘ with the incident electric field. what is the average intensity of the wave after it passes through polarizer a? what is the average intensity of the wave after it passes through polarizer b? suppose that the two polarizers a and b are interchanged. what would the average intensity be after passing through both polarizers?

Answers: 2

Answer

Physics, 22.06.2019 12:30

Which governments provide garbage collection services to homes and businesses

Answers: 3

Answer

Physics, 22.06.2019 16:50

Which best describes the first law of thermodynamics as compared to the second law of thermodynamics? a. the first law describes how thermal energy is conserved but not the direction it moves. b. the first law describes the direction thermal energy moves but not how it is conserved. c. the first law describes how thermal energy can be created but not how it can be destroyed. d. the first law describes how thermal energy can be destroyed but not how it can be created.

Answers: 1

Answer

Physics, 22.06.2019 17:30

How does the entropy of steam compare to the entropy of ice?

Answers: 2

Answer

You know the right answer?

A 1.20 kg water balloon will break if it experiences more than 530 N of force. Your 'friend' whips t...

Questions