Physics, 19.08.2019 22:00 duwaunacozad

Vaporization that takes place inside a liquid is called what exactly?

Answers: 1

Show answers

Answers

Answer from: debramknoxx

The process of vaporization taking placing in a liquid is called boiling.

Answer from: Quest

cell differentiation is how generic embryonic cells become specialized cells. this occurs through a process called gene expression. gene expression is the specific combination of genes that are turned on or off (expressed or repressed), and this is what dictates how a cell functions.

explanation:

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 16:30

The mass of a muon is 207 times the electron mass; the average lifetime of muons at rest is 2.21 μs. in a certain experiment, muons moving through a laboratory are measured to have an average lifetime of 7.04 μs. for the moving muons, what are (a) β (b) k, and (c) p? the rest energy of the electron is 0.511 mev.

Answers: 2

Answer

Physics, 22.06.2019 05:00

Red light strikes a metal surface and electrons are ejected. if violet light is now used with a 10% greater intensity, what will happen to the ejection rate (number of ejected electrons per second) and the maximum energy of the electrons? a) greater ejection rate; same maximum energyb) same ejection rate; greater maximum energyc) greater ejection rate; greater maximum energyd) same ejection rate; same maximum energye) none of the above answers are correct

Answers: 1

Answer

Physics, 22.06.2019 09:40

(a) assume the equation x = at^3 + bt describes the motion of a particular object, with x having the dimension of length and t having the dimension of time. determine the dimensions of the constants a and b. (use the following as necessary: l and t, where l is the unit of length and t is the unit of time.) (b) determine the dimensions of the derivative dx/dt = 3at^2 + b. (use the following as necessary: l and t, where l is the unit of length and t is the unit of time.)

Answers: 1

Answer

Physics, 22.06.2019 10:30