Physics, 02.10.2020 23:01 babydoll022299

What is impossible for a machine to do? A. do a greater amount of work than the amount of work done on the machine
B. apply a force in a direction that is different than the direction of the force applied to the machine
C. move an object a greater distance than the distance that part of the machine was moved
D. apply a force that is less than the force that is applied to the machine

Answers: 3

Show answers

Answers

Answer from: binava

Choice A. Without energy storage, the total work output of a machine will not exceed the total work input.

Explanation:

Choice A

Work is the product of force and the distance travelled in the direction of that force.

Indeed, simple machines can alter the size or direction of a force. However, their work output can't exceed the work input to that machine (unless the machine stores some energy- by bending, for example.) Because of frictions and other forms of energy loss, the useful work output of a real machine can even be smaller than the work input to that machine.

The force output of some machines can certainly exceed their force input. However, at the same time, the input part of those machine needs to move a distance that is (more than) proportionally longer compared to the output part of the machine. As a result, the useful work output would be equal to or even smaller than the total work input.

Choice B

A fixed pulley is an example of a machine that applies a force in a direction different from the direction of the force applied to the machine. Pulling the string down will lift up the weight on the other side. A seesaw (a first-class lever) is another real-world example of this kind of machines.

Choice C and D

Tongs are examples of machines where: the distance traveled by the output exceeds that of the input. However, that comes at a price: delivering the same amount of force with a pair of tongs requires more force than without a pair of tongs. That corresponds to choice D: the work output of some machines can be less than the force input to these machines.

At the same time, some extra force input might be required to overcome the friction between parts of the machine. That's another reason why the machine applies less force than the input even if it was designed to apply the same amount of force.

Answer from: Quest

explanation: magnetic pole, region at each end of a magnet where the external magnetic field is strongest. the south-seeking pole, or any pole similar to it, is called a south magnetic pole. unlike poles of different magnets attract each other; like poles repel each other.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 03:30

Will give brainliest! jay rides his 2.0-kg skateboard. he is moving at speed 5.8 m/s when he pushes off the board and continues to move forward in the air at 5.4 m/s. the board now goes forward at 13 m/s.a. determine jay’s mass.b. determine the change in the internal energy of the system during this process.(express your answer to two significant figures and include the appropriate units.)

Answers: 1

Answer

Physics, 22.06.2019 05:50

Acylinder with a movable piston contains 11.7 moles of a monatomic ideal gas at a pressure of 1.32×10^5 pa. the gas is initially at a temperature of 300 k. an electric heater adds 43200 j of energy into the gas while the piston moves in such a way that the pressure remains constant. cp=20.79 j k^−1 mol^−1 for a monatomic ideal gas, and that the number of gas molecules is equal to avogadro's number (6.022×10^23) times the number of moles of the gas. (a) what is the temperature of the gas after the energy is added? (b) what is the change in volume of the gas? (c) how much work is done by the gas during this process?

Answers: 3

Answer

Physics, 22.06.2019 16:30

He latent heat of vaporization for ethyl alcohol is 854 j/g. the amount of energy, rounded to the nearest whole number, needed to change 5.20 grams of ethyl alcohol from a liquid to a gas is

Answers: 2

Answer

Physics, 22.06.2019 17:30

Which basic property determines a colored light's placement on the spectrum of visible light? a. speed b. frequency c. amplitude d. velocity

Answers: 3

Answer

You know the right answer?

What is impossible for a machine to do? A. do a greater amount of work than the amount of work done...

Questions