Physics, 12.11.2020 08:30 kitt90335

A 200 g blob of clay moves with a speed of 10 m/s towards a 300 g cart that is initially at rest. a. What is the momentum of the system before the blob of clay strikes the cart?
b. What must be the momentum of the system after they come together?
c. If the blob of clay sticks to the cart, with what speed will the clay and cart move after they come together?

Answers: 3

Show answers

Answers

Answer from: mistycascaden

a. 2 kg*m/s

b. $p_{T_{f}} = 0.5v_{f} = 2 kg*m/s$

c. 4 m/s

Explanation:

a. The momentum of the system ( $p_{Ti}$ ) before the blob of clay strikes the cart is:

$p_{Ti} = p_{b} + p_{c}$

Where:

$p_{b}$ is the momentum of the blob clay

$p_{c}$ is the momentum of the car

$p_{Ti} = m_{b}v_{b} + m_{c}v_{c}$

Since the car is initially at rest, $v_{c}$ = 0

$p_{Ti} = 200 g*\frac{1 kg}{1000 g}*10 m/s + 0 = 2 kg*m/s$

b. The momentum of the system after they come together:

$p_{T_{f}} = m_{b}v_{b} + m_{c}v_{c}$

Since they come together, $v_{b}$ =

$p_{T_{f}} = v_{f}(m_{b} + m_{c}) = v_{f}(0.2 kg + 0.3 kg) = 0.5v_{f}$ (1)

Because we do not have the final speed we can not calculate the final momentum.

c. We can find the speed of the clay and car by conservation of the momentum:

$p_{i} = p_{f}$

The initial momentum of the system was founded in part "a" (p = 2 kg*m/s), so we have:

$2 kg*m/s = m_{b}v_{b_{f}} + m_{c}v_{c_{f}}$

Again, when they come together, the final speed is the same:

$2 kg*m/s = v_{f}(m_{b} + m_{c})$

$v_{f} = \frac{2 kg*m/s}{0.2 kg + 0.3 kg} = 4 m/s$

Now, since we found the final speed we can calculate the momentum of the system after they come together (equation 1):

$p_{T} = 0.5v_{f} = 0.5 kg*4m/s = 2 kg*m/s$

I hope it helps you!

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Tell me the answers for your question and you!

Another question on Physics

Physics, 22.06.2019 05:00

Which statements describe the movement of ocean currents around the globe? check all that apply. strong winds force warm water to sink to the ocean floor. the coriolis effect causes warm and cold water to mix. cool dense water sinks to the ocean floor. warm water replaces cool surface water. wind blowing parallel to the shore causes upwelling of cool water.

Answers: 1

Answer

Physics, 22.06.2019 21:10

How do you know how many valence electrons an atom has?

Answers: 1

Answer

Physics, 23.06.2019 01:00

What happens when the vapor pressure of a liquid is equal to the external pressure?

Answers: 1

Answer

Physics, 23.06.2019 01:00

7types of electromagnetic waves from lowest to highest frequency