Physics, 24.11.2020 04:10 awsome12dusk

A pelican flying along a horizontal path drops a fish from a height of 4 m. The fish travels 8.0 m horizontally before it hits the water below. What is the pelican’s speed Pls solve to the fullest do not copy question and give very detail of how to do it pls and thank you

Answers: 3

Show answers

Answers

Answer from: SmokeyRN

Speed = 8.79m/s

Explanation:

Given the following data;

Height = 4m

Horizontal distance = 8m

To find the time, we would use the second equation of motion

S = ut + ½at²

We know that acceleration due to gravity is equal to 9.8m/s²

Initial velocity, u = 0

Substituting into the equation, we have;

4 = 0(t) + ½*9.8*t²

4 = 0 + 4.9*t²

4 = 4.9t²

t² = 4/4.9

t² = 0.82

Taking the square root of both sides, we have;

t = 0.91 secs

To find the speed;

Speed = horizontal distance/time

Speed = 8/0.91

Speed = 8.79m/s

Therefore, the pelican's speed is 8.79 meters per seconds.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

2b2t

explanation:

2b2t

Another question on Physics

Physics, 22.06.2019 09:00

As a pendulum bob swings back and forth several times, the maximum height it reaches becomes less and less. this is because more and more of the pendulum bob's energy is being transformed into a. heat energy b. kinetic energy c. potential energy d. kinetic energy and potential energy

Answers: 2

Answer

Physics, 22.06.2019 09:30

True or false graphs must include scales that increase by the same amount

Answers: 3

Answer

Physics, 22.06.2019 15:30

Ametal ring 4.20 cm in diameter is placed between the north and south poles of large magnets with the plane of its area perpendicular to the magnetic field. these magnets produce an initial uniform field of 1.12 t between them but are gradually pulled apart, causing this field to remain uniform but decrease steadily at 0.240 t/s . (a) what is the magnitude of the electric field induced in the ring? (b) in which direction (clockwise or counterclockwise) does the current flow as viewed by someone on the south pole of the magnet?

Answers: 2

Answer

Physics, 22.06.2019 20:00

Bahan yang digunakan mencegah terjadinya polarisasi pada batu baterai a.larutan h2so4b.mncl2 dan serbuk karbonc.pbso4d.nh4cl

Answers: 3

Answer

You know the right answer?

A pelican flying along a horizontal path drops a fish from a height of 4 m. The fish travels 8.0 m h...

Questions