Physics, 07.12.2020 19:20 12335555cvusd

PLZ HURRY WILL GIVE BRAINILESTT TO FIRST PERSON TO ANSWER:D Read this excerpt from Through the Looking-Glass by Lewis Carroll.

Alice never could quite make out, in thinking it over afterwards, how it was that they began: all she remembers is, that they were running hand in hand, and the Queen went so fast that it was all she could do to keep up with her: and still the Queen kept crying "Faster! Faster!” but Alice felt she COULD NOT go faster, though she had not breath left to say so.

What question should a reader ask to clarify what is happening in the story?
ANSWERS:
A. Why is Alice out of breath?

B. How do Alice and the Queen travel?

C. Where are Alice and the Queen going?

D. Who else enjoys the company of the Queen?

Answers: 2

Show answers

Answers

Answer from: layah7981

c where are Alice and the queen going

Explanation:

we already know that Alice is out of breath because she is running so its not that

we know the queen and Alice are running

we don't need to know who enjoys the company of the queen if we are in a part if the story that is nerve-racking

so that leaves us with where are Alice and the queen going

hope this helps

Answer from: Quest

“when two plates carrying continents collide, the continental crust buckles and rocks pile up, creating towering mountain ranges. when an ocean plate collides with another ocean plate or with a plate carrying continents, one plate will bend and slide under the other. this process is called subduction. “ i found this on google i hope it

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 15:30

1kg of water needs to recieve 4200j of energy to go from 90 degrees to 91 degrees. what is the specific heat capacity of water? what are the units?

Answers: 1

Answer

Physics, 22.06.2019 18:30

A1000-kg car is moving at 30 m/s around a horizontal unbanked curve whose diameter is 0.20 km. what is the magnitude of the friction force required to keep the car from sliding?

Answers: 3

Answer

Physics, 22.06.2019 22:20

One hazard of space travel is debris left by previous missions. there are several thousand masses large enough to detect by radar orbiting the earth, but there are far greater numbers of very small masses such as flakes of paint. calculate the force exerted by a 0.110 mg chip of paint that strikes a space shuttle window at a relative speed of 5.00 ✕ 103 m/s and sticks, given the collision lasts 6.00 ✕ 10-8 s. such a collision chipped the window of the ill-fated challenger in june 1983, causing $50,000 of damage.

Answers: 2

Answer

Physics, 22.06.2019 23:40

Consider a u-tube whose arms are open to the atmosphere. now equal volumes of water and light oil (ρ = 49.3 lbm/ft3) are poured from different arms. a person blows from the oil side of the u-tube until the contact surface of the two fluids moves to the bottom of the u-tube, and therefore, the liquid levels in the two arms are the same. if the fluid height in each arm is 30 in, determine the gage pressure exerted by the person on the oil by blowing.

Answers: 3

Answer

You know the right answer?

PLZ HURRY WILL GIVE BRAINILESTT TO FIRST PERSON TO ANSWER:D Read this excerpt from Through the Look...

Questions