Physics, 09.12.2020 19:30 ronniethefun

Bx=-1.33m and By=2.81m. find the magnitude of the vector.

Answers: 1

Show answers

Answers

Answer from: Quest

to be honest as much as i would love to answer this. i feel as if something's missing. just saying.

Answer from: Quest

sleep paralysis is a parasomnia, events associated with sleep.

sleep paralysis happens when you are in the middle of waking up or falling asleep. it is the feeling of being conscious but unable to move. it definitely involves hallucinations.

i had a friend that had sleep paralysis and he told me a story one time where he was laying in bed and he couldn't move his body no matter how hard he tried and there was someone standing in the corner of his room coming towards him. he couldn't move and you can't "wake up" because you are already conscious. sometimes sleep paralysis can be triggered by frequent waking up during the night based off of multiple trips to the bathroom, or if you had ever been abused, sleep paralysis can start happening from things like that.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

find the surface area of the sphere to the nearest square unit. use a calculator.

a. 254 in.2

b. 64 in.2

c. 127 in.2

d. 1,018 in.2

Another question on Physics

Physics, 21.06.2019 18:00

Awind turbine is initially spinning at a constant angular speed. as the wind's strength gradually increases, the turbine experiences a constant angular acceleration 0.173 rad/s2. after making 2870 revolutions, its angular speed is 132 rad/s. (a) what is the initial angular velocity of the turbine? (b) how much time elapses while the turbine is speeding up?

Answers: 1

Answer

Physics, 22.06.2019 19:10

Due sun 06/09/2019 11: 59 pm skip navigation questions correct q 1 [1/1] correct q 2 [1/1] correct q 3 [1/1] untried q 4 (0/1) untried q 5 (0/1) untried q 6 (0/1) untried q 7 (0/1) untried q 8 (0/1) untried q 9 (0/1) untried q 10 (0/1) grade: 3/10 print version start of questions two cyclists, 42 miles apart, start riding toward each other at the same time. one cycles 2 times as fast as the other. if they meet 2 hours later, what is the speed (in mi/h) of the faster cyclist?

Answers: 1

Answer

Physics, 22.06.2019 20:00

An element becomes a positively charged ion when itloses protons.loses electrons.gains electrons.gains neutrons.

Answers: 2

Answer

Physics, 23.06.2019 02:10

The average atmospheric pressure on earth is approximated as a function of altitude by the relation patm = 101.325 (1 − 0.02256z)5.256, where patm is the atmospheric pressure in kpa, and z is the altitude in km with z = 0 at sea level. determine the approximate atmospheric pressures at atlanta (z = 306 m), denver (z = 1610 m), mexico city (z = 2309 m), and the top of mount everest (z = 8848 m).

Answers: 3

Answer

You know the right answer?

Bx=-1.33m and By=2.81m. find the magnitude of the vector....

Questions