A spaceship of mass 100 kg, headed toward Earth, has a speed of 12,000 m/s relative to the planet when it is 5 Earth radii from Earth’s center. Neglect the effects of Earth’s atmosphere on the spaceship. ME=5.98x1024 kg, RE=6.37x106 m, G=6.67x10-11 m3/kg-s2.

Express energy in scientific notation for example 123456 is 1.2346x10^5

Find the initial gravitational potential energy of the system.

Find the kinetic energy of the system.

Find the mechanical energy of the system.

Find the spaceship’s speed when it reaches the Earth’s surface. Round it to a whole number.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

    5.5 n======    assuming that      we have      m = 0.145 kg    a = 38 m/s²therefore    5.51 n, but two significant figures.final answer: 5.5 n

Ais the answer hope this