Physics, 06.04.2021 16:14 smthcrm

If an object possesses 500 J of potential energy, how much work is needed to lift this object? a) 500 J

b) 250 J

c) 150 J

d) 1000 J

Answers: 1

Show answers

Answers

Answer from: xaniawashington

a) 500 J

Explanation:

Potential energy can be defined as an energy possessed by an object or body due to its position.

Mathematically, potential energy is given by the formula;

P.E = mgh

Where,

P.E represents potential energy measured in Joules.

m represents the mass of an object.

g represents acceleration due to gravity measured in meters per seconds square.

h represents the height measured in meters.

In Science, the potential energy possessed by an object or body is the same as the work done by the object or body.

Since we know that the object possessed 500 Joules of potential energy; it would ultimately require to do a work of 500 Joules to lift the object.

Mathematically, work done = force * distance

But force = mass * acceleration due to gravity

F = mg; d = h

Substituting into the work done formula, we have;

Hence, Workdone = Fd = mgh

Answer from: Quest

The correct answer is c

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 14:40

You throw a small rock straight up from the edge of a highway bridge that crosses a river. the rock passes you on its way down, 7.00 s after it was thrown. what is the speed of the rock just before it reaches the water 28.0 m below the point where the rock left your hand? ignore air resistance.

Answers: 2

Answer

Physics, 22.06.2019 22:00

Awhite-blue star is hotter than a red star. select the best answer from the choices provided true or false

Answers: 2

Answer

Physics, 23.06.2019 05:40

Which of the following can enter and exit a closed system? a. matter and energy b. neither energy nor matter c. matter but not energy d. enrgy but not matter

Answers: 1

Answer

Physics, 23.06.2019 11:00

The safe load, l, of a wooden beam of width w, height h, and length l, supported at both ends, varies directly as the product of the width and the square of the height, and inversely as the length. a wooden beam 4 inches wide, 9 inches high, and 240 inches long can hold a load of 6810 pounds. what load would a beam 3 inches wide, 8 inches high, and 144 inches long, of the same material, support? (round off your answer to the nearest integer.)

Answers: 1

Answer

You know the right answer?

If an object possesses 500 J of potential energy, how much work is needed to lift this object? a) 5...

Questions