Physics, 17.05.2021 16:40 maystrenko53

What is the concentration of H^ + at apH = 2 ? Mol / L What is the concentration of H^ + ions at apH = 6 ? Mol/L How many more H^ + ions are there in a solution at a pH = 2 than in a solution at a pH = 6?

Answers: 3

Show answers

Answers

Answer from: famouzgal

The concentration of hydrogen ion at pH is equal to 2 : = [H^+]=0.01 mol/L

The concentration of hydrogen ion at pH is equal to 6 : [H^+]'=0.000001 mol/L

There are 0.009999 more moles of H^+ ions in a solution at a pH = 2 than in a solution at a pH = 6.

Explanation:

The pH of the solution is the negative logarithm of hydrogen ion concentration in an aqueous solution.

$pH=-\log [H^+]$

The hydrogen ion concentration at pH is equal to 2 = [H^+]

$2=-\log [H^+]\\$

$[H^+]=10^{-2}M= 0.01 M=0.01 mol/L$

The hydrogen ion concentration at pH is equal to 6 = [H^+]

$6=-\log [H^+]\\\\$

$[H^+]=10^{-6}M= 0.000001 M= 0.000001 mol/L$

Concentration of hydrogen ion at pH is equal to 2 = [H^+]=0.01 mol/L

Concentration of hydrogen ion at pH is equal to 6 = [H^+]'=0.000001 mol/L

The difference between hydrogen ion concentration at pH 2 and pH 6 :

= [H^+]-[H^+]' = 0.01 mol/L- 0.000001 mol/L = 0.009999 mol/L

Moles of hydrogen ion in 0.009999 mol/L solution :

$=0.009999 mol/L\times 1 L=0.009999 mol$

There are 0.009999 more moles of H^+ ions in a solution at a pH = 2 than in a solution at a pH = 6.

Answer from: Quest

as a general rule, scissors have blades less than 6 in (15 cm) long and usually have handles with finger holes of the same size. shears have blades scissors used to cut hair or fabric must be much sharper.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 22:50

If the temperature were raised very high, classically what would we expect the heat capacity per object to be for this one-dimensional system? give a numerical value. chigh t = __ j/k/object (one reason for the discrepancy is that the high-temperature limit assumes that the number of oscillators is large (n > > 1), which is not the case in this tiny system.)

Answers: 2

Answer

Physics, 22.06.2019 06:00

Suppose water is leaking from a tank through a circular hole of area ah at its bottom. when water leaks through a hole, friction and contraction of the stream near the hole reduce the volume of water leaving the tank per second to cah 2gh , where c (0 < c < 1) is an empirical constant. a tank in the form of a right-circular cone standing on end, vertex down, is leaking water through a circular hole in its bottom. (assume the removed apex of the cone is of negligible height and volume.) (a) suppose the tank is 20 feet high and has radius 8 feet and the circular hole has radius 2 inches. the differential equation governing the height h in feet of water leaking from a tank after t seconds is dh dt = − 5 6h3/2 . if the height of the water is initially 8 feet, how long will it take the tank to empty? (round your answer to two decimal places.)

Answers: 2

Answer

Physics, 22.06.2019 06:30

From 0 to 5 seconds john pushed a box 5 meters. from 5 to 10 seconds, paul pushed the same box another 5 meters. who did more work? a. john b. paul c. john and paul did the same amount of work.

Answers: 1

Answer

Physics, 22.06.2019 16:30

He latent heat of vaporization for ethyl alcohol is 854 j/g. the amount of energy, rounded to the nearest whole number, needed to change 5.20 grams of ethyl alcohol from a liquid to a gas is

Answers: 2

Answer

You know the right answer?

What is the concentration of H^ + at apH = 2 ? Mol / L What is the concentration of H^ + ions at apH...

Questions