Physics, 23.07.2021 23:00 violetmeadow4

What type of potential energy is a 9 volt battery an example of? Gravitational potential energy
Elastic potential energy
Electrical potential energy
chemical potential energy

Answers: 2

Show answers

Answers

Answer from: deaishaajennings123

chemical potential energy

Explanation:

A 9v battery comes in different formats, such that the most common one is the carbon-zinc and alkaline chemistry, so these are alkaline batteries (there are also rechargeable or lithium batteries, these also depend on chemical interactions).

These batteries "draw" the energy from chemical interactions of the materials inside of it, so the type of potential energy that is stored in a battery is actually chemical (regardless of the fact that the energy can be transformed into electrical energy later) the "potential" refers to how the energy is stored.

Then the correct option is chemical potential energy

Answer from: Quest

the answer is a)

mark brainliest

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 02:00

The motor m applies a time-varying force of f (200 t) n, where t is in seconds. box b with mass 200 kg starts from rest, and the coefficients of kinetic and static friction are 0.2 and us 0.3 the acceleration due to gravity is g 9.8 m/s2 b 300 a) find the time ' when the box starts to move. b) calculate the speed of the crate at 3 s c) calculate the power delivered by the motor at t 3 s

Answers: 3

Answer

Physics, 22.06.2019 08:30

Determine the age of a fossil if it had only one eighth of its original carbon-14 content remaining?

Answers: 3

Answer

Physics, 22.06.2019 11:10

An isotope undergoes radioactive decay by emitting radiation that has a –1 charge. what other characteristic does the radiation have?

Answers: 3

Answer

Physics, 22.06.2019 22:00

Ahurricane sweeps across the ocean and damages the houses of people living along the coast. which of these does not play any role in this interaction? air water glaciers living things

Answers: 1

Answer

You know the right answer?

What type of potential energy is a 9 volt battery an example of? Gravitational potential energy

Questions