Physics, 10.08.2021 14:00 Daisysolis136

A stone that is dropped freely from rest traveled half the total height in the last second. with what velocity will it strike the ground

Answers: 2

Show answers

Answers

Answer from: lilytimpsonx

hell :) ur ans is 33.5 m/s

At time t, the displacement is h/2:

Δy = v₀ t + ½ at²

h/2 = 0 + ½ gt²

h = gt²

At time t+1, the displacement is h.

Δy = v₀ t + ½ at²

h = 0 + ½ g (t + 1)²

h = ½ g (t + 1)²

Set equal and solve for t:

gt² = ½ g (t + 1)²

2t² = (t + 1)²

2t² = t² + 2t + 1

t² − 2t = 1

t² − 2t + 1 = 2

(t − 1)² = 2

t − 1 = ±√2

t = 1 ± √2

Since t > 0, t = 1 + √2. So t+1 = 2 + √2.

At that time, the speed is:

v = at + v₀

v = g (2 + √2) + 0

v = g (2 + √2)

If g = 9.8 m/s², v = 33.5 m/s.

Answer from: Quest

Learned about life itself

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 17:10

The “death throes” of stars are amongst the most complex phenomena in all of astronomy, and the “corpses” of stars amongst the most energetic and exotic objects in existence. beginning at the end of the core helium fusion stage in a star’s life, describe in detail the post-main sequence development of both (a) a 1.0 solar mass star, and (b) a 25.0 solar mass star. in what significant ways do they differ? what role does each of these types of stars play in the "star-gas-star" cycle and the evolution of chemical elements in our galaxy?

Answers: 1

Answer

Physics, 21.06.2019 23:30

Acoil formed by wrapping 80 turns of wire in the shape of a square is positioned in a magnetic field so that the normal to the plane of the coil makes an angle of 28.0° with the direction of the field. when the magnetic field is increased uniformly from 200 µt to 600 µt in 0.400 as, an emf of magnitude 80.0 mv is induced in the coil. what is the total length of the wire?

Answers: 3

Answer

Physics, 22.06.2019 03:00

Arotating space station is said to create “artificial gravity”—a loosely-defined term used for an acceleration that would be crudely similar to gravity. the outer wall of the rotating space station would become a floor for the astronauts, and centripetal acceleration supplied by the floor would allow astronauts to exercise and maintain muscle and bone strength more naturally than in non-rotating space environments. if the space station is 200 m in diameter, what angular velocity would produce an “artificial gravity” of 9.80 m/s^{2} 2 at the rim?

Answers: 3

Answer

Physics, 22.06.2019 04:50

Describe the function of the endomembrane system? what organelles are involved?

Answers: 3

Answer

You know the right answer?

A stone that is dropped freely from rest traveled half the total height in the last second. with wha...

Questions