Physics, 29.08.2021 14:00 biaxialpower789

Can someone help me this question

Answers: 3

Show answers

Answers

Answer from: jerseygirl6167

Volume of wood is 68-50 = 18 cm³

Explanation:

Hope it helps you

Answer from: Quest

most voltage drop calculators want the distance between the source and destination. then internally, they double it so both the source and return wires are calculated. but you need to know which distance the calculator uses so you're not half of what you should be or double what you should be.

most circuit breakers will not take a #6 directly, so the electrician will have to splice on a smaller pigtail. you also have to upsize the grounding wire when you upsized the ungrounded (hot) wire (see note in 250.122). this will preclude using most cable assemblies, as a cable with #6 copper will most likely only have a #10 grounding conductor. you need a #6 grounding conductor if the circuit is 20a. a #8 cable is no better, as it will have a #10 grounding conductor too. but most 20a breakers will take a #8 directly.

in your related post, you didn't say what type of load this is. if it is a light or heater, voltage drop won't be a big issue. if this is a motor, the current needs are huge at startup and the voltage drop can pose a problem. if this is a motor, knowing if the motor is under much load during startup will answer the voltage drop effect (a saw is easier to start than a compressor).

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 01:30

Ablock of mass 1.5 kg slides down an inclined plane that has an angle of 15. if the inclined plane has no friction and the block starts at a height of 3 m, how much kinetic energy does the block have when it reaches the bottom? acceleration due to gravity is g = 9.8 m/s2. a. 6.8 j b. 50.9 j c. 0 j d. 44.1 j

Answers: 1

Answer

Physics, 22.06.2019 05:30

James is trying to prove newton's 2nd law of motion. he tries to move four different objects with different masses, shapes, and sizes from point a to point b. the objects are a toy car, a car, a refrigerator, and a kitchen table. after some experimentation, he finds that force is dependent on the mass of the object, rather than it's size or shape. the object that takes the most force to move is the

Answers: 1

Answer

Physics, 22.06.2019 09:30

Which of these is not a possible type of energy transformation? a. electrical energy into light energy b. sound energy into nuclear energy c. potential energy into kinetic energy d. kinetic energy into mechanical energy

Answers: 1

Answer

Physics, 23.06.2019 00:00

Why do atoms emit energy of only specific wavelengths

Answers: 1

Answer

You know the right answer?

Can someone help me this question
...

Questions