The eiffel tower is a steel structure whose height increases by 19.5 cm when the temperature changes from −8 to +42 °c. what is the approximate height (in meters) at the lower temperature? m

 The coefficient of expansion is 13 * 10^-6 m per meter length.per oK 
The temperature difference = 42 - - 8 = 50 oC 
delta T = (42 + 273) - (-8 + 273) = 50 oK 
delta L = L * 13* 10^6 m/oK 
oK = 50 oK delta L = 19.5 cm = 19.5 cm [1m / 100 cm] = 0.195m 
So we need to find the length and it is computed by:
0.195= L * 13 * 10^-6 * 50 L = 0.195 / (13*10^-6*50) L = 300 m 

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Tons?