Dielectrics 583 reflect as w creases when the es some energy sct as we would expect, the potential difference when the capacitors are connected because the first me across c de energy to the second one. since the two capacitors have the the first capacitor are in parallel, but the concept of an equivalent capaci- came they are in converted to other forms: the conductors become a little warmer, and some energy is radiated as electromagnetic waves. we'll study these phenomena in later chapters practice problem: in this example, if c = 80 mf (equal to c). what fraction of the original stored energy remains after c is connected to c ?50%. ce is not needed here. see that the final stored energy is only 65% of the initial value. moves to the new capacitor, some of the stored energy is as charge moves to 18.7 dielectrics
convert the condensed structures to line angle formulas: 1. ch3ch2ch(ch3)ch2ch3 8. chcoch 9. ch3ch2och3 2. ch3ch2ch(ch2ch3)ch(ch3)ch2cho ch)ch: chch: 10. ch ch2ch=c(ch: chb)(c(ch3)3)ch, 3. ch3ch2ch(ch3)ch(ch3)ch2ch3 11. ch: ch-ch(ch2ch)ch oh 4. ch3c(ch3)2ch2ch2ch(ch3)ch2ch3 12. ch3ch2och2cho 5. ch(ch3)2ch(ci)ch2ch3 13. hoocch2nhch(ch3)coch3 6. ch3ch2ch och(ch2ch3)ch2ch3 14. hoocch och cooh 7. hoch: c(ch3)2conh2

1b. convection2f. the same

Cobalt (co)hoped i

  balanced chemical equations follow the law of conservation of mass and charges. the masses and charges on either sides of the equation should be balanced.in conservation of mass, the number of atoms of each element on left side should be equal to the number of atoms of each element on the right side of the equation.1)k₂so₄ + 2ca(no₃)₂ --> 2kno₃ + 2caso₄number of ions        left side             right side  k⁺         2                         2so₄²⁻   1                         2ca²⁺     2                         2no₃⁻     4                         2in this equation the masses of so₄²⁻ and no₃ are not balanced. therefore this equation violates the law of conservation of mass2)ti + 2 cl₂ > ticl₄        left side       right side  ti           1               1cl           4               4this equation follows the law of conservation of mass3)2c₂h₂ + 5o₂ > 4co₂   + 2h₂o              left side     right side  c               4               4h               4               4o             10             10this equation follows the law of conservation of mass4)baso₄ + 2naoh --> ba(oh)₂   + na₂so₄          left side       right side  ba       1                   1so₄²⁻     1                   1na         2                   2  oh⁻       2                   2this equation follows the law of conservation of massanswer is 1st equation