CH3CHClCH(CH3)CH2CH2CH2CH2Br name the molecule iupac rules please

How many neutrons does an element have if its atomic number is 50 and its mass number is 166

How do you determine the percent yield of a chemical reaction

To prevent the presence of air, noble gases are placed over highly reactive chemicals to act as inert "blanketing" gases. a chemical engineer places a mixture of noble gases consisting of 4.37 g of he, 13.36 g of ne, and 36.65 g of kr in a piston-cylinder assembly at stp. calculate the partial pressure in torr of kr.