At night, the demand for electricity supplied by a fission nuclear reactor decreases. how is the fission nuclear reaction controlled to avoid overproduction of electricity? the temperature of the reactor is lowered because high temperature and pressure are needed. the temperature of the reactor is raised because the reaction slows down at higher temperatures. the exposure between the fuel rods and a neutron-absorbing material is increased. the exposure between the fuel rods and a neutron-absorbing material is reduced.

Answer is C, hope it helps

The correct answer is The exposure between the fuel rods and a neutron-absorbing material is increased

Explanation:

The only way to control or stop a nuclear chain reaction is to stop the neutrons from splitting more atoms. Control rods made of a neutron-absorbing element such as boron reduce the number of free neutrons and take them out of the reaction. These control rods are placed near the nuclear rods and they act like magnets. These control rods actually attracts the neutron and avoid them from hitting more atoms so if they are more exposed their effect will be more prominent therefore in this way the nuclear chain reaction can be controlled.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o