Physics, 26.06.2019 04:30 joejoefofana

The visible part of the spectrum of light is where you can find which of the following. a. all colours b. only blue c. only blue and red d. only red

Answers: 1

Show answers

Answers

Answer from: camosloppy7677

The answer is A my good fellow

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the aurora is formed when charged particles emitted from the sun during a solar flare penetrate the earth's magnetic shield and collide with atoms and molecules in our atmosphere. these collisions result in countless little bursts of light, called photons, which make up the aurora.

auroras are generated by charged solar particles hitting molecules in earth's atmosphere. this usually happens in high latitudes, because our planet’s magnetic field tends to funnel these particles toward the poles. that’s why it can be experienced in northern ohio.

Another question on Physics

Physics, 22.06.2019 07:30

30 points - when can a theory be modified if a new type of technology allows for new observations that raise new questions? a. immediately, while the questions about the theory are being asked b. after new hypotheses related to the theory are tested in experiments c. only after the new observations disprove all parts of the theory d. while scientists begin to think about how the theory could improve

Answers: 1

Answer

Physics, 22.06.2019 08:20

A3030 cmcm wrench is used to loosen a bolt with a force applied 0.30.3 mm from the bolt. it takes 6060 nn to loosen the bolt when the force is applied perpendicular to the wrench. how much force would it take if the force was applied at a 3030 degree angle from perpendicular? a 3030 cmcm wrench is used to loosen a bolt with a force applied 0.30.3 mm from the bolt. it takes 6060 nn to loosen the bolt when the force is applied perpendicular to the wrench. how much force would it take if the force was applied at a 3030 degree angle from perpendicular?

Answers: 3

Answer

Physics, 22.06.2019 21:50

Which of the following is part of the explanation or description of electromagnetic waves? (select all that apply) a. electrically charged molecules in a medium transfer their energy to nearby electrically charged molecules. b. a changing electric field causes a changing magnetic field. c. magnetic molecules in a medium transfer their energy to nearby magnetic molecules. d. a changing magnetic field causes a changing electric field.

Answers: 3

Answer

Physics, 23.06.2019 00:50

Which of the following is not an appropriate unit for acceleration? (kg/12 mihr? m/min/sec cm/30c?

Answers: 2

Answer

You know the right answer?

The visible part of the spectrum of light is where you can find which of the following. a. all colou...

Questions